- 4-Thiouracil
-
- $1.00 / 1KG
-
2020-05-15
- CAS: 591-28-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20T
- 4-THIOURACIL
-
- $1.00 / 1kg
-
2019-07-06
- CAS:591-28-6
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 200kg
|
| | 4-THIOURACIL Basic information |
| Product Name: | 4-THIOURACIL | | Synonyms: | 4-Thiouracil97%;4-Thiouracil 97%;2(1H)-Pyrimidinone, 3,4-dihydro-4-thioxo- (9CI);4-Thiouracil ,98%;4-Thioxo-1H-pyrimidin-2-one;2-HYDROXY-4-MERCAPTOPYRIMIDINE / 4-THIOURACIL;4-thiouracyl;4-sulfanylidene-1,2,3,4-tetrahydropyriMidin-2-one | | CAS: | 591-28-6 | | MF: | C4H4N2OS | | MW: | 128.15 | | EINECS: | | | Product Categories: | PYRIMIDINE | | Mol File: | 591-28-6.mol |  |
| | 4-THIOURACIL Chemical Properties |
| Melting point | 295 °C (dec.) (lit.) | | density | 1.368 (estimate) | | refractive index | 1.7000 (estimate) | | storage temp. | Store at -20°C | | solubility | 1 M NaOH: soluble50mg/mL | | pka | 5.38±0.20(Predicted) | | form | Powder | | color | Yellow | | InChI | InChI=1S/C4H4N2OS/c7-4-5-2-1-3(8)6-4/h1-2H,(H2,5,6,7,8) | | InChIKey | OVONXEQGWXGFJD-UHFFFAOYSA-N | | SMILES | C1(=O)NC=CC(=S)N1 | | CAS DataBase Reference | 591-28-6(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 36 | | WGK Germany | 3 | | HS Code | 29335990 |
| | 4-THIOURACIL Usage And Synthesis |
| Description | 4-Thiouracil is a site-specific, photoactivatable probe used to detect RNA structures and nucleic acid-nucleic acid contacts. It absorbs ultraviolet light >300 nm and, in the presence of oxygen, acts as an energy donor to produce singlet oxygen by triplet-triplet energy transfer. The highly reactive oxygen species then reacts readily with 4-thiouracil, leading to the production of uracil and uracil-6-sulfonate, which is fluorescent at a wavelength of ~390 nm. 4-Thiouracil is used as a T. gondii uracil phosphoribosyltransferase substrate to produce 4-thiouridine monophosphate, which can ultimately be incorporated into RNA. | | Chemical Properties | yellow powder | | Uses | 4-Thiouracil is suitable reagent employed in Schneider′s media for the embryos during RNA extraction. It may be employed as reagent for the Northwestern blotting technique. | | Uses | 4-Thiouracil is a derivative of Uracil (U801000), which is a nitrogenous base in RNA nucleic acid. 4-Thiouracil is used for tagging in cell type-specific RNA isolation from intact complex tissues. | | Synthesis Reference(s) | Synthesis, p. 256, 1987 DOI: 10.1055/s-1987-27906 | | References | [1] MICHAEL R MILLER. TU-tagging: cell type–specific RNA isolation from intact complex tissues[J]. Nature Methods, 2009, 6 6: 439-441. DOI: 10.1038/nmeth.1329
[2] XIAORAN ZOU. Photophysical and Photochemical Properties of 4-Thiouracil: Time-Resolved IR Spectroscopy and DFT Studies[J]. The Journal of Physical Chemistry B, 2014, 118 22: 5864-5872. DOI: 10.1021/jp501658a
[3] GUSTI M ZEINER. RNA analysis by biosynthetic tagging using 4-thiouracil and uracil phosphoribosyltransferase.[J]. Methods in molecular biology, 2008, 419: 135-146. DOI: 10.1007/978-1-59745-033-1_9 |
| | 4-THIOURACIL Preparation Products And Raw materials |
|