|
|
| | N-Fmoc-N-Methyl-O-tert-butyl-L-serine Basic information |
| Product Name: | N-Fmoc-N-Methyl-O-tert-butyl-L-serine | | Synonyms: | N-Fmoc-N-Methyl-O-tert-butyl-L-serine;(S)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)(methyl)amino)-3-tert-butoxypropanoic acid;2-[[9H-fluoren-9-ylmethoxy(oxo)methyl]-methylamino]-3-[(2-methylpropan-2-yl)oxy]propanoic acid;(2S)-3-(tert-butoxy)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}(methyl)amino)propanoic acid;FMOC-N-METHYL-O-TERT-BUTYL-L-SERINE;N-FMoc-O-tert-butyl-N-Methyl-L-serine, 97%;Fmoc-N-Me-L-Ser(tBu)-OH;Fmoc-N-methyl-O-tert-butyl-L-serine≥ 98% (HPLC) | | CAS: | 197632-77-2 | | MF: | C23H27NO5 | | MW: | 397.47 | | EINECS: | 1533716-785-6 | | Product Categories: | amino acids;Fmoc-Amino acid series;Serine [Ser, S];N-Methyl Amino Acids | | Mol File: | 197632-77-2.mol |  |
| | N-Fmoc-N-Methyl-O-tert-butyl-L-serine Chemical Properties |
| Melting point | 213-218℃ | | Boiling point | 557.5±50.0 °C(Predicted) | | density | 1.204±0.06 g/cm3(Predicted) | | storage temp. | Store at +2°C to +8°C. | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 3.46±0.10(Predicted) | | form | Crystalline Solid | | color | White to off-white | | Major Application | peptide synthesis | | InChI | InChI=1S/C23H27NO5/c1-23(2,3)29-14-20(21(25)26)24(4)22(27)28-13-19-17-11-7-5-9-15(17)16-10-6-8-12-18(16)19/h5-12,19-20H,13-14H2,1-4H3,(H,25,26)/t20-/m0/s1 | | InChIKey | PQSAXALAXPNFMG-FQEVSTJZSA-N | | SMILES | C(O)(=O)[C@H](COC(C)(C)C)N(C(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)C | | CAS DataBase Reference | 197632-77-2(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 2924 29 70 | | HazardClass | IRRITANT | | Storage Class | 13 - Non Combustible Solids |
| | N-Fmoc-N-Methyl-O-tert-butyl-L-serine Usage And Synthesis |
| Chemical Properties | White to off-white crystalline powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | N-Fmoc-N-Methyl-O-tert-butyl-L-serine Preparation Products And Raw materials |
|