| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
3,3'-BIANISOLE manufacturers
- 3,3'-BIANISOLE
-
-
2019-11-08
- CAS:6161-50-8
- Min. Order: 1g
- Purity: 99.5%min
- Supply Ability: 20kg/week
|
| | 3,3'-BIANISOLE Basic information |
| Product Name: | 3,3'-BIANISOLE | | Synonyms: | 3,3'-BIANISOLE;3,3'-Dimethoxy-1,1'-biphenyl;Biphenyl, 3,3'-dimethoxy-;3 3-DIMETHOXYBIPHENYL 97%;3 3-BIANISOLE 97%;Einecs 228-187-6;3,3′-Dimethoxybiphenyl,3,3′-Bianisole;1,1'-Biphenyl, 3,3'-dimethoxy- | | CAS: | 6161-50-8 | | MF: | C14H14O2 | | MW: | 214.26 | | EINECS: | 228-187-6 | | Product Categories: | | | Mol File: | 6161-50-8.mol |  |
| | 3,3'-BIANISOLE Chemical Properties |
| Melting point | 44-45 °C(lit.) | | Boiling point | 328 °C(lit.) | | density | 1.0781 (rough estimate) | | refractive index | 1.5570 (estimate) | | Fp | >230 °F | | form | solid | | InChI | 1S/C14H14O2/c1-15-13-7-3-5-11(9-13)12-6-4-8-14(10-12)16-2/h3-10H,1-2H3 | | InChIKey | UCHNVSDXSPIKRG-UHFFFAOYSA-N | | SMILES | COc1cccc(c1)-c2cccc(OC)c2 |
| WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | 3,3'-BIANISOLE Usage And Synthesis |
| Uses | 3,3''-Dimethoxy-1,1''-biphenyl is a useful reactant in organic synthesis. |
| | 3,3'-BIANISOLE Preparation Products And Raw materials |
|