|
|
| | 2,2'-DIMETHOXYBIPHENYL Basic information |
| Product Name: | 2,2'-DIMETHOXYBIPHENYL | | Synonyms: | 2,2'-DIMETHOXYBIPHENYL;Fluorescent Spectral Standard A, certified;FLUORESCENCE QY-STANDARD A CERTIFIED;2,2'-Bi[anisole];2,2'-Dimethoxy-1,1'-biphenyl;2,2'-Dimethoxybiphenyl,98%;2,2'-Dimethyoxybiphenyl;1,1'-Biphenyl, 2,2'-dimethoxy- | | CAS: | 4877-93-4 | | MF: | C14H14O2 | | MW: | 214.26 | | EINECS: | | | Product Categories: | | | Mol File: | 4877-93-4.mol |  |
| | 2,2'-DIMETHOXYBIPHENYL Chemical Properties |
| Melting point | 153-157 °C | | Boiling point | 307.5°C (estimate) | | density | 1.2680 | | refractive index | 1.5570 (estimate) | | storage temp. | Inert atmosphere,2-8°C | | solubility | Soluble in chloroform, methanol. | | form | Solid | | color | White to Off-White | | BRN | 2051625 | | InChI | InChI=1S/C14H14O2/c1-15-13-9-5-3-7-11(13)12-8-4-6-10-14(12)16-2/h3-10H,1-2H3 | | InChIKey | VGMKUVCDINAAFC-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2OC)=CC=CC=C1OC | | CAS DataBase Reference | 4877-93-4(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | F | 10 |
| | 2,2'-DIMETHOXYBIPHENYL Usage And Synthesis |
| Chemical Properties | 2,2'-DIMETHOXYBIPHENYL is crystalline powder | | Uses | 2,2'-DIMETHOXYBIPHENYL is used in the synthesis of biphenyl scaffolds in the preparation of biphenyl-tetrathiafulvalene derivatives. | | Uses | 2,2-Dimethoxy-1,1-biphenyl is used in the synthesis of biphenyl scaffolds in the preparation of biphenyl-tetrathiafulvalene derivatives. |
| | 2,2'-DIMETHOXYBIPHENYL Preparation Products And Raw materials |
|