|
|
| | 3-METHOXY-2-NITROBENZOIC ACID Basic information | | Uses |
| | 3-METHOXY-2-NITROBENZOIC ACID Chemical Properties |
| Melting point | 253-257 °C (lit.) | | Boiling point | 334.23°C (rough estimate) | | density | 1.430 | | refractive index | 1.5700 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystaline | | pka | 2.07±0.10(Predicted) | | color | White to Almost white | | BRN | 2214986 | | InChI | 1S/C8H7NO5/c1-14-6-4-2-3-5(8(10)11)7(6)9(12)13/h2-4H,1H3,(H,10,11) | | InChIKey | YMOMYSDAOXOCID-UHFFFAOYSA-N | | SMILES | COc1cccc(C(O)=O)c1[N+]([O-])=O | | CAS DataBase Reference | 4920-80-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29189900 | | Storage Class | 11 - Combustible Solids |
| | 3-METHOXY-2-NITROBENZOIC ACID Usage And Synthesis |
| Uses | 3-Methoxy-2-nitrobenzoic acid is a white to pale beige powder and is an intermediate in the preparation of many pharmaceuticals and fragrances. Because its aromatic ring contains multiple reactive groups such as nitro and carboxyl groups, it has wide applications in the pharmaceutical and chemical industries. | | Chemical Properties | white to light beige powder |
| | 3-METHOXY-2-NITROBENZOIC ACID Preparation Products And Raw materials |
|