| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| Product Name: | 3-Methoxy-2-nitrobenzoic acid | | Synonyms: | RARECHEM AL BE 0677;2-NITRO-3-METHOXYBENZOIC ACID;2-NITRO-M-ANISIC ACID;Benzoic acid, 3-methoxy-2-nitro-;m-Anisic acid, 2-nitro-;3-METHOXY-2-NITROBENZOIC ACID 98+%;3-METHOXY-2-NITROBENZOIC ACID 99+%;2-Nitro-3-Methoxybenzoic acid (3-Methoxy-2-nitrobenzoic acid) | | CAS: | 4920-80-3 | | MF: | C8H7NO5 | | MW: | 197.14 | | EINECS: | 225-549-5 | | Product Categories: | C8;Carbonyl Compounds;Carboxylic Acids | | Mol File: | 4920-80-3.mol |  |
| | 3-Methoxy-2-nitrobenzoic acid Chemical Properties |
| Melting point | 253-257 °C (lit.) | | Boiling point | 334.23°C (rough estimate) | | density | 1.430 | | refractive index | 1.5700 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystaline | | pka | 2.07±0.10(Predicted) | | color | White to Almost white | | BRN | 2214986 | | InChI | 1S/C8H7NO5/c1-14-6-4-2-3-5(8(10)11)7(6)9(12)13/h2-4H,1H3,(H,10,11) | | InChIKey | YMOMYSDAOXOCID-UHFFFAOYSA-N | | SMILES | COc1cccc(C(O)=O)c1[N+]([O-])=O | | CAS DataBase Reference | 4920-80-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29189900 | | Storage Class | 11 - Combustible Solids |
| | 3-Methoxy-2-nitrobenzoic acid Usage And Synthesis |
| Preparation | Dissolve 100 mL of water and an appropriate amount of NaOH, then add 6.9 g (50 mmol) of 3-methyl-2-nitrophenol. Heat to a certain temperature, then slowly add dimethyl sulfate dropwise for about 1 hour. Monitor the reaction with TLC until p-hydroxybenzoic acid reacts completely. Cool to room temperature and adjust the pH to approximately 1. When a large amount of white solid precipitates, filter, wash three times with deionized water, dry, and weigh. The experiment uses a batch reaction method, and the system is a gas-liquid two-phase catalytic system. A quartz glass oxidation vessel is used as the reaction apparatus, air as the oxidant, and cobalt naphthenate as the catalyst. Before the reaction begins, 3-methoxy-2-nitrotoluene and the catalyst are evenly added to the reaction vessel, and the vessel is tightened, all valves are closed, and a pressure test is performed. An appropriate amount of nitrogen is introduced into the reaction vessel, and the valves are closed, displaying a certain pressure value. Wait half an hour and observe whether the pressure gauge reading decreases. If the container is sealed, release the gas and begin heating, while gradually increasing the stirring rate of the oxidation vessel. After the set reaction conditions are met, air is introduced into the oxidation reactor at a set flow rate. To prevent the liquid from evaporating and being carried away by the air, a reflux condenser is installed externally. To maintain temperature stability, a heating mantle is used to regulate the temperature outside the quartz glass stirred reactor. At the end of the reaction, the liquid is discharged through the lower outlet of the quartz glass oxidation reactor. After the reaction liquid cools, the middle portion is collected for analysis. The target compound, 3-methoxy-2-nitrobenzoic acid, is obtained. | | Uses | 3-Methoxy-2-nitrobenzoic acid is a white to pale beige powder and is an intermediate in the preparation of many pharmaceuticals and fragrances. Because its aromatic ring contains multiple reactive groups such as nitro and carboxyl groups, it has wide applications in the pharmaceutical and chemical industries. | | Chemical Properties | white to light beige powder |
| | 3-Methoxy-2-nitrobenzoic acid Preparation Products And Raw materials |
|