|
|
| | 3-Methoxy-2-nitrobenzaldehyde Basic information |
| | 3-Methoxy-2-nitrobenzaldehyde Chemical Properties |
| Melting point | 97-101 °C (lit.) | | Boiling point | 344.2±27.0 °C(Predicted) | | density | 1.322±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Crystalline Powder | | color | White to beige or yellow | | BRN | 1959385 | | InChI | 1S/C8H7NO4/c1-13-7-4-2-3-6(5-10)8(7)9(11)12/h2-5H,1H3 | | InChIKey | GDTUACILWWLIJF-UHFFFAOYSA-N | | SMILES | [H]C(=O)c1cccc(OC)c1[N+]([O-])=O | | CAS DataBase Reference | 53055-05-3(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 29130000 | | Storage Class | 11 - Combustible Solids |
| | 3-Methoxy-2-nitrobenzaldehyde Usage And Synthesis |
| Chemical Properties | White to beige or yellow crystalline powder | | Uses | 3-Methoxy-2-nitrobenzaldehyde was used in the synthesis of 8-hydroxyquinazoline, methy-3-methoxyanthranilate and 3-methoxy-2-nitrobenzylidenebisformamide. | | General Description | 3-Methoxy-2-nitrobenzaldehyde undergoes 1,4-diazabicyclo[2.2.2]octane-catalyzed reaction with methyl vinyl ketone (MVK) to afford normal Baylis-Hillman adduct, the MVK dimer and a pair of diastereomeric bis-(MVK)Baylis-Hillman adducts. |
| | 3-Methoxy-2-nitrobenzaldehyde Preparation Products And Raw materials |
|