|
|
| | SPIRAEOSIDE Basic information |
| Product Name: | SPIRAEOSIDE | | Synonyms: | Quercetin 4′-O-β-D-glucopyranoside;4'-(β-D-Glucopyranosyloxy)-3,5,5',7-tetrahydroxyflavone;4'-[(β-D-Glucopyranosyl)oxy]-3,3',5,7-tetrahydroxyflavone;Qercetin-4'-O-β-D-glucoside;Spireoside;2-(4-(beta-d-glucopyranosyloxy)-3-hydroxyphenyl)-3,5,7-trihydroxy-4h-1-benzo;4h-1-benzopyran-4-one,2-(4-(beta-d-glucopyranosyloxy)-3-hydroxyphenyl)-3,5,7-t;spiraein(acacia) | | CAS: | 20229-56-5 | | MF: | C21H20O12 | | MW: | 464.38 | | EINECS: | 243-614-6 | | Product Categories: | Miscellaneous Natural Products | | Mol File: | 20229-56-5.mol |  |
| | SPIRAEOSIDE Chemical Properties |
| Melting point | 209-211°C | | Boiling point | 835.6±65.0 °C(Predicted) | | density | 1.809±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | form | Solid | | pka | 6.31±0.40(Predicted) | | color | Light yellow to yellow | | Major Application | food and beverages | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | InChIKey | OIUBYZLTFSLSBY-HMGRVEAOSA-N | | SMILES | OC[C@H]1O[C@@H](Oc2ccc(cc2O)C3=C(O)C(=O)c4c(O)cc(O)cc4O3)[C@H](O)[C@@H](O)[C@@H]1O | | LogP | -0.380 (est) |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | SPIRAEOSIDE Usage And Synthesis |
| Uses | Quercetin 4''-Glucoside was found to be a pigment flavonoid in Montmorency cherries. Quercetin 4''-Glucoside has been seen to increase the antioxidant capacity of blood plasma. | | Definition | ChEBI: Quercetin 4'-O-beta-D-glucopyranoside is a quercetin O-glucoside that is quercetin with a beta-D-glucosyl residue attached at position 4'. It has a role as a plant metabolite, an antioxidant and an antineoplastic agent. It is a beta-D-glucoside, a monosaccharide derivative, a quercetin O-glucoside, a tetrahydroxyflavone and a member of flavonols. It is functionally related to a beta-D-glucose. It is a conjugate acid of a quercetin 4'-O-beta-D-glucopyranoside(1-). | | in vivo | Spiraeoside (50 mg/kg, p.o.) shows ulcer preventive ability[2].
| Animal Model: | Male Wistar rats (6-8 weeks old)[2]. | | Dosage: | 50 mg/kg. | | Administration: | Oral gavage an hour before inducing the lesions. | | Result: | Decreased severity of the formed lesions. |
|
| | SPIRAEOSIDE Preparation Products And Raw materials |
|