|
|
| | Bis(3,5-dimethylphenyl)phosphine Basic information |
| Product Name: | Bis(3,5-dimethylphenyl)phosphine | | Synonyms: | Bis(3,5-dimethylphenyl)phosphine,99%;98% [(CH3)2C6H3]2PH;Bis(3,5-diMethylphenyl)phosphine, 98% (10% solution in hexanes);Phosphine, bis(3,5-dimethylphenyl)-;Bis(3,5-dimethylphenyl);bis(3,5-dimethylphenyl)phosphane;Bis(3,5-dimethylphenyl)phosphine, 98% (10wt% in hexanes);Bis(3,5-dimethyL | | CAS: | 71360-06-0 | | MF: | C16H19P | | MW: | 242.3 | | EINECS: | | | Product Categories: | organophosphine | | Mol File: | 71360-06-0.mol |  |
| | Bis(3,5-dimethylphenyl)phosphine Chemical Properties |
| Boiling point | 368.8±42.0 °C(Predicted) | | density | 1.017 g/mL at 25 °C | | refractive index | n20/D1.599 | | Fp | >110℃ | | form | liquid | | color | colorless | | Sensitive | air sensitive | | InChI | InChI=1S/C16H19P/c1-11-5-12(2)8-15(7-11)17-16-9-13(3)6-14(4)10-16/h5-10,17H,1-4H3 | | InChIKey | GPFIUEZTNRNFGD-UHFFFAOYSA-N | | SMILES | P(C1=CC(C)=CC(C)=C1)C1=CC(C)=CC(C)=C1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 26-36/37/39 | | RIDADR | UN 3334 | | WGK Germany | 3 | | HS Code | 29319090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Bis(3,5-dimethylphenyl)phosphine Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | Bis(3,5-dimethylphenyl)phosphine can be used as a reactant to prepare:
- Iron(II) chiral diimine diphosphine complexes as catalysts for the asymmetric transfer hydrogenation of ketones.
- The complex of iridium with biphenol phosphite-phosphine bidentate ligand as an asymmetric catalyst for the hydrogenation of N-arylimines.
- Chiral phosphines with excellent stereoselectivity by 1, 4 addition reaction with α,β-unsaturated aldehydes using a palladium catalyst.
| | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: ligand |
| | Bis(3,5-dimethylphenyl)phosphine Preparation Products And Raw materials |
|