|
|
| | 3-(Methylamino)propionic acid Basic information |
| Product Name: | 3-(Methylamino)propionic acid | | Synonyms: | N-Methyl-b-aminopropionicAcid;N-Methyl--aminopropionic Acid;RARECHEM AL BO 1090;N-METHYL-BETA-ALANINE;beta-alanine, N-methyl-;N-methyl-beta-alanine(SALTDATA: HCl);N-Methyl-beta-aminopropionic acid;3-(METHYLAMINO)PROPIONIC ACID USP/EP/BP | | CAS: | 2679-14-3 | | MF: | C4H9NO2 | | MW: | 103.12 | | EINECS: | | | Product Categories: | Amino Acids & Derivatives | | Mol File: | 2679-14-3.mol |  |
| | 3-(Methylamino)propionic acid Chemical Properties |
| Melting point | 164-166°C | | Boiling point | 217℃ | | density | 1.052 | | refractive index | 1.4451 | | Fp | 85℃ | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | pka | 3.66±0.12(Predicted) | | color | White | | Stability: | Hygroscopic | | InChI | InChI=1S/C4H9NO2/c1-5-3-2-4(6)7/h5H,2-3H2,1H3,(H,6,7) | | InChIKey | VDIPNVCWMXZNFY-UHFFFAOYSA-N | | SMILES | C(CNC)C(=O)O |
| Hazard Codes | Xi | | Risk Statements | 36 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2922498590 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 3-(Methylamino)propionic acid Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Parakeratosis inhibitor, commonly found in skin care products to shrink pores. | | Definition | ChEBI: N-methyl-beta-alanine is a beta-amino acid that is propionic acid in which one of the hydrogens at position 3 has been replaced by a methylamino group. It is a beta-amino acid and a secondary amino compound. It is functionally related to a beta-alanine. |
| | 3-(Methylamino)propionic acid Preparation Products And Raw materials |
|