- CVT-313
-
- $35.00
-
2026-07-27
- CAS:199986-75-9
- Purity: 97.46%
- Supply Ability: 10g
|
| | 2(Bis-(hydroxyethyl)amino)-6-(4-methoxybenzylamino)-9-isopropyl-purine Basic information |
| | 2(Bis-(hydroxyethyl)amino)-6-(4-methoxybenzylamino)-9-isopropyl-purine Chemical Properties |
| Boiling point | 652.3±65.0 °C(Predicted) | | density | 1.30±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | solubility | ≥20 mg/mL in DMSO; insoluble in H2O; ≥51.1 mg/mL in EtOH with gentle warming | | pka | 13.95±0.10(Predicted) | | form | White solid | | color | White to off-white | | biological source | rabbit | | InChI | 1S/C20H28N6O3/c1-14(2)26-13-22-17-18(21-12-15-4-6-16(29-3)7-5-15)23-20(24-19(17)26)25(8-10-27)9-11-28/h4-7,13-14,27-28H,8-12H2,1-3H3,(H,21,23,24) | | InChIKey | NQVIIUBWMBHLOZ-UHFFFAOYSA-N | | SMILES | [n]1(c2nc(nc(c2nc1)NCc3ccc(cc3)OC)N(CCO)CCO)C(C)C |
| WGK Germany | WGK 1 | | Storage Class | 11 - Combustible Solids |
| | 2(Bis-(hydroxyethyl)amino)-6-(4-methoxybenzylamino)-9-isopropyl-purine Usage And Synthesis |
| Uses | CVT 313 is a potent CDK2 inhibitor. | | Biological Activity | Cell permeable: yes', 'Primary Target Cdk2/A, Cdk2/E', 'Product competes with ATP.', 'Reversible: yes', 'Target IC50: 0.5 μM for Cdk2/A and Cdk2/E; 4.2 μM for Cdk1/B; 215 μM for Cdk4/D1 | | IC 50 | cdk2/cyclin A: 0.5 μM (IC50); Cdk1/cyclin B: 4.2 μM (IC50); Cdk4/cyclin D1: 215 μM (IC50) | | storage | Store at -20°C |
| | 2(Bis-(hydroxyethyl)amino)-6-(4-methoxybenzylamino)-9-isopropyl-purine Preparation Products And Raw materials |
|