- Benzo-15-crown-5
-
-
2026-06-30
- CAS:14098-44-3
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1000kg
- Benzo-15-crown-5
-
-
2025-06-27
- CAS:14098-44-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
|
| | Benzo-15-crown-5 Basic information |
| Product Name: | Benzo-15-crown-5 | | Synonyms: | Benzo-15-crown-5, 99% 2.5GR;CROWN ETHER/BENZO-15-CROWN-5 FOR SYNTHES;2,5,8,11,14-Pentaoxabicyclo[13.4.0]nonadeca-15,17,19-triene;1,2-[Oxybis(ethyleneoxyethyleneoxy)]benzene;2,5,8,11,14-Pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene;6,7,9,10,12,13,15,16-Octahydro-5,8,11,14,17-pentaoxa-5H-benzocyclopentadecene;Benzo-15-crown-5,99%;denzo15c5 | | CAS: | 14098-44-3 | | MF: | C14H20O5 | | MW: | 268.31 | | EINECS: | 237-947-6 | | Product Categories: | crown ether;Crown Ethers;Functional Materials;Macrocycles for Host-Guest Chemistry;Chelation/Complexation Compounds;Crown Ethers;Synthetic Reagents | | Mol File: | 14098-44-3.mol |  |
| | Benzo-15-crown-5 Chemical Properties |
| Melting point | 78-80 °C (lit.) | | Boiling point | 371.47°C (rough estimate) | | density | 1.1846 (rough estimate) | | refractive index | 1.4825 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | form | Powder or Flakes | | color | Almost white to light gray | | Water Solubility | partially soluble | | Sensitive | Hygroscopic | | BRN | 1624106 | | InChI | InChI=1S/C14H20O5/c1-2-4-14-13(3-1)18-11-9-16-7-5-15-6-8-17-10-12-19-14/h1-4H,5-12H2 | | InChIKey | DSFHXKRFDFROER-UHFFFAOYSA-N | | SMILES | O1C2=CC=CC=C2OCCOCCOCCOCC1 | | CAS DataBase Reference | 14098-44-3(CAS DataBase Reference) | | NIST Chemistry Reference | Bis(1,4,7,10,13-benzopentaoxacyclopentadecin, 2,3,5,6,8,9,11,12-octahydro-)(14098-44-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25-36-26 | | WGK Germany | 3 | | RTECS | DI5400000 | | F | 3-10 | | Hazard Note | Irritant | | HS Code | 29329995 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
2,3,5,6,8,9,11,12-Octahydro-1,4,7,10,13-benzopentaoxacyclopentadecin
| English |
|
ACROS
| English |
|
SigmaAldrich
| English |
|
ALFA
| English |
| | Benzo-15-crown-5 Usage And Synthesis |
| Chemical Properties | ALMOST WHITE TO LIGHT GREY POWDER OR FLAKES | | Uses | Benzo-15-crown-5 is used in synthetic chemistry. It plays a major role and involved in complexation through ether oxygen. It is used in phase-transfer catalyst system. It is involved in 'Host-Guest' chemistry to identify the move of essential elements in the body. It can play the part of very complicated biological reactions such as enzyme functions, which finds application in the development of new pharmaceuticals. | | Preparation | synthesis of Benzo-15-crown-5: benzo-15-crown-5 can be produced using Williamson synthesis reaction, featured by interaction between catechol (orto-dihydroxybenzene) and tetraethylene glycol dichloride (1,10-dichloro-3,6,9-trioxadecane) over sodium hydroxide in the n-butanol media (30-h inertatmosphere boiling). The yield of benzo-15-crown-5 produced by this method is 62%, with the basic substance's mass fraction of 95%.
Production of Macrocyclic Polyether Benzo-15-Crown-5 and its Functional Derivatives
| | Application | Benzo-15-crown-5 can be used for sol-gel material extraction to separate lithium isotopes, for making static detection sensors for formic acid gases, and as metal ion complexing agent and phase transfer reagent. | | Definition | ChEBI: Benzo-15-crown-5 is a crown ether that is 15-crown-5 ortho-fused to a benzene ring. |
| | Benzo-15-crown-5 Preparation Products And Raw materials |
| Raw materials | Sodium hydroxide-->Tetrahydrofuran-->Tosyl chloride-->Catechol-->Tetrabutylammonium iodide-->GLYCOFUROL-->Ethane, 1,1'-oxybis[2-(2-iodoethoxy)--->O,O'-Bis(2-hydroxyethoxy)benzene-->2,2'-(2,2'-(1,2-phenylenebis(oxy))bis(ethane-2,1-diyl))bis(oxy)diethanol-->(1,2-phenylenebis(oxy))bis(ethane-2,1-diyl)bis(4-methylbenzenesulfonate)-->4'-Bromobenzo-15-crown 5-ether-->4'-Formylbenzo-15-crown 5-ether-->Ethane,1,1'-Oxybis〔2-(2-bromoethoxy)--->Pentaethylene Glycol Dimethanesulfonate-->Tetraethylene glycol di-p-tosylate-->Diethylene glycol bis(p-toluenesulfonate) | | Preparation Products | ethylene dimethanesulfonate |
|