|
|
| | D-Lysine hydrochloride Basic information |
| | D-Lysine hydrochloride Chemical Properties |
| Melting point | 266 °C (dec.)(lit.) | | alpha | -21 º (c=8, 6N HCl) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | H2O: soluble | | form | Crystalline Powder | | color | White | | Water Solubility | SOLUBLE | | BRN | 4356907 | | Major Application | peptide synthesis | | InChI | InChI=1/C6H14N2O2.ClH/c7-4-2-1-3-5(8)6(9)10;/h5H,1-4,7-8H2,(H,9,10);1H/t5-;/s3 | | InChIKey | BVHLGVCQOALMSV-NUBCRITNSA-N | | SMILES | [C@H](N)(C(=O)O)CCCCN.Cl |&1:0,r| | | CAS DataBase Reference | 7274-88-6(CAS DataBase Reference) | | EPA Substance Registry System | D-Lysine monohydrochloride (7274-88-6) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | RTECS | OL5632500 | | F | 21 | | TSCA | TSCA listed | | HS Code | 29224190 | | Storage Class | 13 - Non Combustible Solids |
| | D-Lysine hydrochloride Usage And Synthesis |
| Description | D-lysine hydrochloride is the hydrochloride salt form of D-lysine. D-lysine is a kind of D-form amino acid (not the natural amino acid in organisms, which is in L-form). It is often supplied to animal feed. D-Lysine is used as a component of polymers (poly-D-lysine), surfactants and biofilms to confer a positive (cationic) charge. The poly-D-lysine can be used to facilitate the attachment of proteins and cells to solid surface through enhancing the electrostatic interaction between negatively-charged ion of the cell membrane and the positively-charged ions of the culture surface. In histochemical field, it is used to coat slides to promote cell attachment. | | Chemical Properties | white crystalline powder | | Uses | D-Lysine is used as a component of a wide array of polymers (poly-D-lysine), surfactants and biofilms to confer a positive (cationic) charge. | | Definition | ChEBI: The hydrochloride salt of D-lysine. | | IC 50 | Human Endogenous Metabolite | | References | https://pubchem.ncbi.nlm.nih.gov/compound/D-Lysine#section=Top
http://www.alamanda-polymers.com/content/poly-l-lysine-and-poly-d-lysine
http://www.sigmaaldrich.com/catalog/product/sigma/l8021lang=zh®ion=CN |
| | D-Lysine hydrochloride Preparation Products And Raw materials |
|