- NHBoc-PEG4-amine
-
-
2025-06-07
- CAS:811442-84-9
- Min. Order: 5g
- Purity: >98.00%
- Supply Ability: 5g
|
| | 5,8,11,14-Tetraoxa-2-azahexadecanoic acid,16-amino-,1,1-dimethyl ester Basic information |
| Product Name: | 5,8,11,14-Tetraoxa-2-azahexadecanoic acid,16-amino-,1,1-dimethyl ester | | Synonyms: | 5,8,11,14-Tetraoxa-2-azahexadecanoic acid,16-amino-,1,1-dimethyl ester;5,8,11,14-Tetraoxa-2-azahexadecanoic acid, 16-aMino-, 1,1-diMethylethyl ester;Boc-NH-PEG4-CH2CH2NH2;O-(2-AMinoethyl)-O'-[2-(Boc-aMino)ethyl]triethylene Glycol;16-Amino-5,8,11,14-tetraoxa-2-azahexadecanoic acid 1,1-dimethylethyl ester;Boc-aMino-PEG-aMine (n=4);t-Boc-N-amido-PEG4-Amine;Boc-N-amido-PEG4-Amine | | CAS: | 811442-84-9 | | MF: | C15H32N2O6 | | MW: | 336.42 | | EINECS: | | | Product Categories: | Aliphatics;Amines;Intermediates;Polyethyleneglycol Derivatives;peg | | Mol File: | 811442-84-9.mol |  |
| | 5,8,11,14-Tetraoxa-2-azahexadecanoic acid,16-amino-,1,1-dimethyl ester Chemical Properties |
| Boiling point | 443.9±40.0 °C(Predicted) | | density | 1.059 | | storage temp. | 2-8°C(protect from light) | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 12.23±0.46(Predicted) | | form | Oil | | color | Colourless | | InChI | InChI=1S/C15H32N2O6/c1-15(2,3)23-14(18)17-5-7-20-9-11-22-13-12-21-10-8-19-6-4-16/h4-13,16H2,1-3H3,(H,17,18) | | InChIKey | WCNWLERBLMBSOT-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NCCOCCOCCOCCOCCN |
| | 5,8,11,14-Tetraoxa-2-azahexadecanoic acid,16-amino-,1,1-dimethyl ester Usage And Synthesis |
| Description | t-Boc-N-amido-PEG4-amine is a Boc proteced PEG linker containing an free amino group. The amino group is reactive with carboxylic acids, activated NHS esters, carbonyls (ketone, aldehyde) etc. The Boc group can be deprotected under mild acidic conditions to form the free amine. | | Uses | As a polyethyleneglycol (PEG) derivative, O-(2-AMinoethyl)-O'-[2-(Boc-aMino)ethyl]triethylene Glycol can be used in the preparation of fluorescent sensors for probing cyclodextrin and proteins. | | IC 50 | Cleavable Linker; PEGs; Alkyl/ether |
| | 5,8,11,14-Tetraoxa-2-azahexadecanoic acid,16-amino-,1,1-dimethyl ester Preparation Products And Raw materials |
|