|
|
| | 3,6-Dimethyl Pyridazine Basic information |
| Product Name: | 3,6-Dimethyl Pyridazine | | Synonyms: | 3,6-Dimethyl Pyridazine;Pyridazine, 3,6-diMethyl-;3,6-dimethylpyridazin;3,6-Dimethyl Pyridazine ISO 9001：2015 REACH | | CAS: | 1632-74-2 | | MF: | C6H8N2 | | MW: | 108.14 | | EINECS: | | | Product Categories: | | | Mol File: | 1632-74-2.mol |  |
| | 3,6-Dimethyl Pyridazine Chemical Properties |
| Melting point | 32-33℃ | | Boiling point | 228℃ | | density | 0.997 | | Fp | 100℃ | | storage temp. | Sealed in dry,Room Temperature | | pka | 4.04±0.10(Predicted) | | Appearance | Light yellow to yellow <32°C Solid,>33°C Liquid | | InChI | InChI=1S/C6H8N2/c1-5-3-4-6(2)8-7-5/h3-4H,1-2H3 | | InChIKey | BGVTUIRPHLSMJU-UHFFFAOYSA-N | | SMILES | C1(C)=NN=C(C)C=C1 |
| | 3,6-Dimethyl Pyridazine Usage And Synthesis |
| Synthesis | Step A: A mixed solution of 2,5-hexanedione (6 mL, 51 mmol) and hydrazine monohydrate (2.5 mL, 51 mmol) in ethanol (50 mL) was heated to reflux for 3 hours. After completion of the reaction, the reaction mixture was concentrated under reduced pressure. The residue was mixed with 10% Pd/C catalyst (1.1 g) in anhydrous benzene (200 mL) and heated to reflux overnight. After the reaction mixture was cooled to room temperature, it was filtered through a diatomaceous earth pad to remove the catalyst. The filtrate was concentrated and purified by silica gel column chromatography (eluent: dichloromethane solution containing 6% methanol) to afford 3,6-dimethylpyrazine (3.1 g, 56% yield) as a light brown oil.1H NMR (500 MHz, CDCl3): δ 7.23 (2H, s), 2.69 (6H, s). | | References | [1] Patent: US9617268, 2017, B2. Location in patent: Page/Page column 395; 396
[2] Journal of the American Chemical Society, 1956, vol. 78, p. 1961,1964
[3] Journal of the American Chemical Society, 1938, vol. 60, p. 2456
[4] Journal of the Chemical Society - Dalton Transactions, 1996, # 10, p. 2117 - 2122
[5] Gazzetta Chimica Italiana, 1950, vol. 80, p. 783,786 |
| | 3,6-Dimethyl Pyridazine Preparation Products And Raw materials |
| Raw materials | Pyridazine, 4-chloro-3,6-dimethyl--->4(1H)-Pyridazinone, 3,6-bis(chloromethyl)--->4(1H)-Pyridazinone, 3,6-bis(hydroxymethyl)--->2,5-dihydro-2,5-dimethoxy-2,5-dimethylfuran-->Pyrimidine, 4,5-dimethyl- (6CI,7CI,8CI,9CI)-->Pyrimidine, 2,4-dimethyl- (6CI,7CI,8CI,9CI)-->3-Hexyn-2,5-diol-->2,6-Dimethylpyrazine-->2,5-Dimethylfuran-->2,5-Hexanedione | | Preparation Products | 3,6-PYRIDAZINEDICARBOXYLIC ACID |
|