|
|
| | 3,4,5-TRIMETHOXYBENZAMIDE Basic information |
| Product Name: | 3,4,5-TRIMETHOXYBENZAMIDE | | Synonyms: | 3,4,5-TRIMETHOXYBENZAMIDE;3,4,5-trimethoxy-benzamid;TriMethoxybenzaMide;3,4,5-triMethoxybenzoicaMide;http://www.shshiji.coM/ProductInfo.aspxPID=11479;Benzamide, 3,4,5-trimethoxy-;Troxipide Impurity 1;3,4,5-Trimethoxybenzamide > | | CAS: | 3086-62-2 | | MF: | C10H13NO4 | | MW: | 211.21 | | EINECS: | 221-406-6 | | Product Categories: | Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts;Amides;Carbonyl Compounds;Organic Building Blocks | | Mol File: | 3086-62-2.mol |  |
| | 3,4,5-TRIMETHOXYBENZAMIDE Chemical Properties |
| Melting point | 179-184 °C(lit.) | | Boiling point | 350.89°C (rough estimate) | | density | 1.2545 (rough estimate) | | refractive index | 1.5150 (estimate) | | storage temp. | Storage temp. 2-8°C | | pka | 15.95±0.50(Predicted) | | Appearance | White to off-white Solid | | BRN | 2697325 | | InChI | InChI=1S/C10H13NO4/c1-13-7-4-6(10(11)12)5-8(14-2)9(7)15-3/h4-5H,1-3H3,(H2,11,12) | | InChIKey | GGNMTJKRHHLJHH-UHFFFAOYSA-N | | SMILES | C(N)(=O)C1=CC(OC)=C(OC)C(OC)=C1 | | CAS DataBase Reference | 3086-62-2(CAS DataBase Reference) | | EPA Substance Registry System | Benzamide, 3,4,5-trimethoxy- (3086-62-2) |
| Safety Statements | 22-24/25 | | WGK Germany | 2 | | RTECS | CV6125000 | | TSCA | TSCA listed | | HS Code | 29242990 |
| | 3,4,5-TRIMETHOXYBENZAMIDE Usage And Synthesis |
| | 3,4,5-TRIMETHOXYBENZAMIDE Preparation Products And Raw materials |
| Raw materials | N-(tert-butyl)-3,4,5-trimethoxybenzamide-->Galocitabine-->1,2-Diiodobenzene-->Benzene, 5-ethynyl-1,2,3-triMethoxy--->3,4,5-TRIMETHOXYBENZANILIDE-->3,4,5-Trimethoxybenzonitrile-->3,4,5-Trimethoxybenzylamine-->5'-Deoxy-5-fluorocytidine-->3,4,5-TRIMETHOXYBENZALDEHYDE OXIME-->Iodobenzene-->3,4,5-Trimethoxy benzoic acid-->3',4',5'-TRIMETHOXYACETOPHENONE-->3,4,5-Trimethoxybenzyl alcohol-->3,4,5-Trimethoxybenzaldehyde | | Preparation Products | 3,4,5-Trimethoxyaniline-->Trimethobenzamide |
|