| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
|
| | (R)-Boc-Nipecotic acid Basic information |
| | (R)-Boc-Nipecotic acid Chemical Properties |
| Boiling point | 353.2±35.0 °C(Predicted) | | density | 1.164±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 4.49±0.20(Predicted) | | form | Crystalline Powder | | color | White | | BRN | 5539297 | | Major Application | peptide synthesis | | InChI | InChI=1S/C11H19NO4/c1-11(2,3)16-10(15)12-6-4-5-8(7-12)9(13)14/h8H,4-7H2,1-3H3,(H,13,14)/t8-/m1/s1 | | InChIKey | NXILIHONWRXHFA-MRVPVSSYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC[C@@H](C(O)=O)C1 | | CAS DataBase Reference | 163438-09-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (R)-Boc-Nipecotic acid Usage And Synthesis |
| Chemical Properties | White powder | | Uses | 1-Boc-D-nipecotic acid is used as an organic chemical synthesis intermediate. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis | | Synthesis | Step 1: 3-Piperidinecarboxylic acid (1.05 g, 8.1 mmol) was dissolved in a solvent mixture of tetrahydrofuran (20 mL) and water (20 mL). Di-tert-butyl dicarbonate (2.48 g, 11.4 mmol) and sodium bicarbonate (0.96 g, 11.4 mmol) were added. The reaction mixture was stirred at room temperature overnight. After the reaction was completed, the mixture was diluted with water and ether. The aqueous layer was adjusted to pH=2 with concentrated hydrochloric acid and then extracted with dichloromethane. The organic layers were combined, dried over sodium sulfate, and concentrated to give (R)-1-(tert-butoxycarbonyl)piperidine-3-carboxylic acid (1.8 g, 97% yield). retention time by LCMS (Condition A) = 3.26 min, and m/z = 230 ([M+H]+) was observed by mass spectrum. | | References | [1] Patent: WO2005/14540, 2005, A1. Location in patent: Page/Page column 39 [2] Journal of Medicinal Chemistry, 2011, vol. 54, # 19, p. 6456 - 6468 [3] Patent: WO2010/120889, 2010, A1. Location in patent: Page/Page column 55; 60 |
| | (R)-Boc-Nipecotic acid Preparation Products And Raw materials |
|