- azido-PEG2-Acid
-
- $0.00 / 10g
-
2025-06-07
- CAS:1312309-63-9
- Min. Order: 10g
- Purity: >98.00%
- Supply Ability: 10g
|
| | Azido-PEG2-acid Basic information |
| Product Name: | Azido-PEG2-acid | | Synonyms: | Azido-PEG2-acid;Azido-PEG3-acid;N3-PEG2-CH2CH2COOH;Azido-PEG2-propionic acid;N3-PEG2-COOH;3-[2-(2-Azidoethoxy)ethoxy]propanoic acid;Azido-PEG2-C2-acid;Azido-PEG2-acid,N3-PEG2-COOH | | CAS: | 1312309-63-9 | | MF: | C7H13N3O4 | | MW: | 203.2 | | EINECS: | | | Product Categories: | peg | | Mol File: | 1312309-63-9.mol |  |
| | Azido-PEG2-acid Chemical Properties |
| storage temp. | Storage temp. -20°C | | solubility | good in water and most organic solvents | | form | Liquid | | color | Colorless to light yellow | | Appearance | yellow liquid | | InChI | InChI=1S/C7H13N3O4/c8-10-9-2-4-14-6-5-13-3-1-7(11)12/h1-6H2,(H,11,12) | | InChIKey | IEHDSRSXQAOLJT-UHFFFAOYSA-N | | SMILES | O(CCC(=O)O)CCOCCN=[N+]=[N-] |
| | Azido-PEG2-acid Usage And Synthesis |
| Description | Azido-PEG2-acid is a PEG linker containing an azide group with a terminal carboxylic acid. The hydrophilic PEG spacer increases solubility in aqueous media. The azide group can react with alkyne, BCN, DBCO via Click Chemistry to yield a stable triazole linkage. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. | | Uses | 9-Azido-4,7-dioxanonanoic Acid is used in the synthesis of single-walled carbon nanotubes (SWCNTs) with ssDNA. | | IC 50 | PEGs |
| | Azido-PEG2-acid Preparation Products And Raw materials |
|