- Azido-PEG3-azide
-
- $29.00
-
2026-05-16
- CAS:101187-39-7
- Purity: 99.86%
- Supply Ability: 10g
- N3-PEG3-N3
-
-
2025-06-07
- CAS:101187-39-7
- Min. Order: 5g
- Purity: >95.00%
- Supply Ability: 5g
|
| | 1,11-Diazido-3,6,9-trioxaundecane Basic information |
| | 1,11-Diazido-3,6,9-trioxaundecane Chemical Properties |
| density | 1.170 g/mL at 25 °C | | refractive index | n20/D1.470 | | storage temp. | -20°C | | solubility | Soluble in chloroform, DCM, DMF, DMSO, or THF | | form | Oil | | color | Clear Colourless | | Appearance | colorless liquid | | Boiling point | 163-196°C/760 mmHg | | InChI | InChI=1S/C8H16N6O3/c9-13-11-1-3-15-5-7-17-8-6-16-4-2-12-14-10/h1-8H2 | | InChIKey | SFMMXKLNFMIUCH-UHFFFAOYSA-N | | SMILES | O(CCOCCN=[N+]=[N-])CCOCCN=[N+]=[N-] |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29270000 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 1,11-Diazido-3,6,9-trioxaundecane Usage And Synthesis |
| Description | PEG4 diazide is a hydrophilic linker with two azide groups. Both can be modified by click chemistry, either by a copper catalyzed reaction with terminal alkynes, or by a copper-free reaction with cycloalkynes. Azides can also participate in the Staudinger ligation reaction.
This diazide is useful for the synthesis of dimeric molecules by click chemistry. | | Chemical Properties | Yellowish Oil | | Uses | 1,11-Diazido-3,6,9-trioxaundecane is a useful linker for biomolecules. | | Uses | Homobifunctional PEG azide click chemistry linker. Azide functional groups will react via a copper catalyzed or strain promoted 1,3-dipolar cycloaddition click reaction with terminal alkynes and cyclooctyne derivatives to yield a stable triazole linkage. | | reaction suitability | reaction type: click chemistry
reagent type: cross-linking reagent | | IC 50 | PEGs |
| | 1,11-Diazido-3,6,9-trioxaundecane Preparation Products And Raw materials |
|