| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
- N3-PEG8-NHS
-
-
2026-07-24
- CAS:1204834-00-3
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 1g/bottle, 10g/bottle, 100g/bottle
- Azido-PEG8-NHS ester
-
-
2026-06-30
- CAS:1204834-00-3
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1000kgs
|
| | Azido-PEG8-NHS ester Basic information |
| Product Name: | Azido-PEG8-NHS ester | | Synonyms: | Azido-PEG8-NHS ester;N3-PEG8-CH2CH2COONHS Ester;AZIDO-PEG8-NHS;Azido-dPEG(R)8-NHS ester;N3-PEG8-CH2CH2COONHS;N3-PEG8-NHS Ester,Azido-PEG8-NHS ester;N3-PEG8-SPA;Azido-dPEG??-NHS ester | | CAS: | 1204834-00-3 | | MF: | C23H40N4O12 | | MW: | 564.5833 | | EINECS: | | | Product Categories: | peg | | Mol File: | 1204834-00-3.mol |  |
| | Azido-PEG8-NHS ester Chemical Properties |
| storage temp. | -20°C | | solubility | Soluble in DMSO, DCM, DMF | | form | solid or viscous liquid | | color | Colorless to light yellow | | InChIKey | AZXJVYAMFTUKFC-UHFFFAOYSA-N | | SMILES | O=C(ON1C(CCC1=O)=O)CCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-] |
| WGK Germany | WGK 3 | | HS Code | 3822000000 | | Storage Class | 11 - Combustible Solids |
| | Azido-PEG8-NHS ester Usage And Synthesis |
| Description | Azido-PEG8-NHS ester is a popular click chemistry reagent with an azide and an NHS ester. The hydrophilic PEG spacer increases solubility in aqueous media. The azide group can react with alkyne, BCN, DBCO via Click Chemistry to yield a stable triazole linkage. The NHS ester can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules. | | Uses | Azido-PEG8-NHS ester series of products contain an azide function on one end of a single molecular weight dPEG spacer and a reactive group on the other end of the spacer. The dPEG spacer is hydrophilic and non-immunogenic and improves the water solubility of the target molecule while reducing the immunogenicity and increasing the hydrodynamic volume of the target. | | reaction suitability | reaction type: click chemistry reagent type: cross-linking reagent reaction type: click chemistry | | IC 50 | PEGs; Alkyl/ether; Cleavable Linker |
| | Azido-PEG8-NHS ester Preparation Products And Raw materials |
|