| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| Product Name: | (R)-3-Aminobutyric acid | | Synonyms: | (R)-B-AMINOBUTYRIC ACID;RARECHEM LK HD C012;L-3-Abu-OH;(R)-beta-homo-alanine;(3R)-3-Aminobutanoic acid;(3R)-3-Aminobutyric acid;beta-homo-D-alanine;R-3-ABU-OH | | CAS: | 3775-73-3 | | MF: | C4H9NO2 | | MW: | 103.12 | | EINECS: | | | Product Categories: | 3775-73-3 | | Mol File: | 3775-73-3.mol |  |
| | (R)-3-Aminobutyric acid Chemical Properties |
| Melting point | 215-216 °C | | Boiling point | 223.6±23.0 °C(Predicted) | | density | 1.105±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Methanol (Slightly), Water (Slightly, Sonicated) | | form | Solid | | pka | 3.67±0.12(Predicted) | | color | White to Off-White | | Optical Rotation | Consistent with structure | | InChI | InChI=1S/C4H9NO2/c1-3(5)2-4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m1/s1 | | InChIKey | OQEBBZSWEGYTPG-GSVOUGTGSA-N | | SMILES | C(O)(=O)C[C@H](N)C |
| | (R)-3-Aminobutyric acid Usage And Synthesis |
| Preparation | (R)-3-aminobutyric acid is obtained by using crotonic acid and ammonium salt as substrates, adding a salt containing magnesium ions, adjusting the pH with ammonia water, adding recombinant aspartate enzyme as a biological enzyme catalyst, reacting under suitable temperature and alkaline conditions, and then separating, purifying and crystallizing the reaction product. | | Chemical Properties | Colorless liquid | | Uses | (R)-3-Aminobutanoic Acid is used in preparation of fused ring Pyrimidone derivatives for use in the treatment of HBV infection or of HBV-induced. diseases |
| | (R)-3-Aminobutyric acid Preparation Products And Raw materials |
|