|
|
| | 1'-HYDROXY-2'-ACETONAPHTHONE Basic information |
| Product Name: | 1'-HYDROXY-2'-ACETONAPHTHONE | | Synonyms: | 2-hydroxy-1-(1-naphthalenyl)ethanone;l’-hydroxy-2’-acetonaphtone;methyl(1-hydroxy-2-naphthyl)ketone;RARECHEM BW GA 0421;TIMTEC-BB SBB010063;LABOTEST-BB LT00068557;Ethanone, 1-(1-hydroxy-2-naphthalenyl)-;Ethanone, 1-(1-Hydroxy-2- | | CAS: | 711-79-5 | | MF: | C12H10O2 | | MW: | 186.21 | | EINECS: | 211-918-8 | | Product Categories: | Aromatic Phenols | | Mol File: | 711-79-5.mol |  |
| | 1'-HYDROXY-2'-ACETONAPHTHONE Chemical Properties |
| Melting point | 98-100 °C(lit.) | | Boiling point | 280.69°C (rough estimate) | | density | 1.1032 (rough estimate) | | refractive index | 1.6086 (estimate) | | storage temp. | 2-8°C, stored under nitrogen | | pka | pK1: 13.40 (30°C) | | form | Crystalline Powder | | color | Yellow | | Water Solubility | Insoluble in water. | | BRN | 1868084 | | InChI | InChI=1S/C12H10O2/c1-8(13)10-7-6-9-4-2-3-5-11(9)12(10)14/h2-7,14H,1H3 | | InChIKey | JBGJVMVWYWUVOW-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C2C(=C1O)C=CC=C2)C | | EPA Substance Registry System | Ethanone, 1-(1-hydroxy-2-naphthalenyl)- (711-79-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29145000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1'-HYDROXY-2'-ACETONAPHTHONE Usage And Synthesis |
| Chemical Properties | yellow crystalline powder | | Uses | 2-acetyl-1-naphthol and 1-acetyl-2-naphthol with triphosgene gave naphtho[1,2-e]-1,3-oxazines, naphtho[2,1-e]-1,3-oxazines or their spiro dimers depending on the molar ratio of triphosgene used for the cyclization. | | General Description | The modulation of different photophysical properties of 1′-hydroxy-2′-acetonaphthone (HAN), after encapsulating into the hydrophobic nanocavities of various bile salt aggregates, was studied. |
| | 1'-HYDROXY-2'-ACETONAPHTHONE Preparation Products And Raw materials |
|