- X-NeuNAc
-
- $36.00
-
2026-07-16
- CAS:160369-85-7
- Purity: 99.91%
- Supply Ability: 10g
|
| | 5-Bromo-4-chloro-3-indolyl-alpha-D-N-acetylneuraminic acid sodium salt Basic information |
| | 5-Bromo-4-chloro-3-indolyl-alpha-D-N-acetylneuraminic acid sodium salt Chemical Properties |
| Melting point | 183°C dec. | | storage temp. | -20°C | | solubility | Ethyl Acetate, Methanol, Water | | form | Solid | | color | White to Off-White | | Water Solubility | water: 50mg/mL, clear, colorless to faintly yellow | | Stability: | Moisture, Temperature sensitive | | InChIKey | MNWWXEDVLXNFDD-GNZCRVNMSA-M | | SMILES | O(C1=CNC2=CC=C(Br)C(Cl)=C12)[C@@]1(C[C@H](O)[C@@H](NC(=O)C)[C@]([H])([C@H](O)[C@H](O)CO)O1)C(=O)O.[NaH] |&1:12,14,16,21,23,25,r| |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-24/25 | | WGK Germany | 1 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids |
| | 5-Bromo-4-chloro-3-indolyl-alpha-D-N-acetylneuraminic acid sodium salt Usage And Synthesis |
| Chemical Properties | Pale Yellow Solid | | Uses | 5-Bromo-4-chloro-3-indolyl α-D-N-acetylneuraminic acid sodium salt has been used as a substrate for determining the neuraminidase enzymatic activity of
- avian mycoplasma samples
- Ornithobacterium rhinotracheale, a poultry pathogen
- canine mycoplasma samples
| | Uses | 5-Bromo-4-chloro-3-indolyl-α-D-N-acetylneuraminic acid sodium salt can be used as a substrate for the detection of sialidase-like enzyme in screening of enzymes, studying physiological activities of gangliosides, and recombinant technologies. |
| | 5-Bromo-4-chloro-3-indolyl-alpha-D-N-acetylneuraminic acid sodium salt Preparation Products And Raw materials |
|