| Company Name: |
BOC Sciences |
| Tel: |
16314854226; +8616314854226 |
| Email: |
inquiry@bocsci.com |
|
| | E3 ligase Ligand-Linker Conjugates 17 Basic information |
| Product Name: | E3 ligase Ligand-Linker Conjugates 17 | | Synonyms: | E3 ligase Ligand-Linker Conjugates 17;E3 Ligase Ligand-Linker Conjugates 20 (TFA);Cereblon Ligand -Linker Conjugates 2 TFA;Pomalidomide Related Compound 6 Triflate;N-(8-Aminooctyl)-2-((2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)oxy)acetamide 2,2,2-trifluoroacetate;N-(8-aminooctyl)-2-((2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)oxy)acetamide trifluoroacetate;Thalidomide-O-amido-C8-NH2 trifluoroacetate;Acetamide, N-(8-aminooctyl)-2-[[2-(2,6-dioxo-3-piperidinyl)-2,3-dihydro-1,3-dioxo-1H-isoindol-4-yl]oxy]-, 2,2,2-trifluoroacetate (1:1) | | CAS: | 1950635-16-1 | | MF: | C25H31F3N4O8 | | MW: | 572.54 | | EINECS: | | | Product Categories: | | | Mol File: | 1950635-16-1.mol |  |
| | E3 ligase Ligand-Linker Conjugates 17 Chemical Properties |
| storage temp. | 2-8°C | | form | Solid | | color | White to off-white | | InChIKey | AJVLNIUPDHKOPS-UHFFFAOYSA-N | | SMILES | O=C(C(F)(F)F)[O-].O=C(COC1=CC=CC(C(N2C3C(NC(CC3)=O)=O)=O)=C1C2=O)NCCCCCCCC[NH3+] |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Acute Tox. 4 Dermal
Repr. 1A |
| | E3 ligase Ligand-Linker Conjugates 17 Usage And Synthesis |
| Uses | Thalidomide-O-amido-C8-NH2 TFA (Cereblon Ligand -Linker Conjugates 2 TFA) is a synthesized E3 ligase ligand-linker conjugate that incorporates the Thalidomide based cereblon ligand and a linker used in PROTAC technology. | | IC 50 | Cereblon | | References | [1] James Bradner, et al. Methods to induce targeted protein degradation through bifunctional molecules. WO 2017024317 A2. |
| | E3 ligase Ligand-Linker Conjugates 17 Preparation Products And Raw materials |
|