|
|
| | 7-METHOXY-1-INDANONE 97 Basic information |
| | 7-METHOXY-1-INDANONE 97 Chemical Properties |
| Melting point | 99-102 °C | | Boiling point | 305℃ | | density | 1.166 | | Fp | 147℃ | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | color | White to Yellow to Orange | | InChI | InChI=1S/C10H10O2/c1-12-9-4-2-3-7-5-6-8(11)10(7)9/h2-4H,5-6H2,1H3 | | InChIKey | CZXBVBATQPHSSL-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=CC=C2OC)CC1 |
| Hazard Codes | Xn | | Risk Statements | 22-36-43 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29145090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Sens. 1 |
| | 7-METHOXY-1-INDANONE 97 Usage And Synthesis |
| Uses | 7-Methoxy-1-indanone can be used to synthesize 10,15-Dihydro-4,9,14-trimethoxy-5H-diindeno[1,2-a;1′,2′-c]fluorene via acid-catalyzed trimerization. | | General Description | 7-Methoxy-1-indanone can be synthesized by using chroman-4-one as the starting material. |
| | 7-METHOXY-1-INDANONE 97 Preparation Products And Raw materials |
|