|
|
| | 5-Methoxy-1-indanone Basic information | | Uses |
| | 5-Methoxy-1-indanone Chemical Properties |
| Melting point | 107-109 °C (lit.) | | Boiling point | 150 °C / 2mmHg | | density | 1.0281 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | Crystalline Powder | | color | Light green-brownish | | Odor Threshold | 0.00048ppm | | BRN | 1282137 | | InChI | InChI=1S/C10H10O2/c1-12-8-3-4-9-7(6-8)2-5-10(9)11/h3-4,6H,2,5H2,1H3 | | InChIKey | QOPRWBRNMPANKN-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=C(OC)C=C2)CC1 | | CAS DataBase Reference | 5111-70-6(CAS DataBase Reference) |
| | 5-Methoxy-1-indanone Usage And Synthesis |
| Uses | 5-Methoxy-1-indanone is a ketone organic compound, mainly used as a pharmaceutical intermediate. | | Chemical Properties | white to light yellow crystal powder | | Uses | The cytotoxic potential of 5-methoxy-1-indanone was assessed. | | Synthesis Reference(s) | Journal of the American Chemical Society, 106, p. 2469, 1984 DOI: 10.1021/ja00320a060
The Journal of Organic Chemistry, 35, p. 647, 1970 DOI: 10.1021/jo00828a022
Tetrahedron Letters, 8, p. 2763, 1967 | | General Description | The cytotoxic potential of 5-methoxy-1-indanone was assessed. |
| | 5-Methoxy-1-indanone Preparation Products And Raw materials |
|