| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- Farnesylacetone
-
- $1.00
-
2020-01-03
- CAS:762-29-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10000KGS
|
| | Farnesylacetone Basic information |
| Product Name: | Farnesylacetone | | Synonyms: | Farnesylacetone technical, mixture of stereo isomers, >=90% (GC);Farnesylacetone, 95%, mixture of isomers;FARNESYLACETONE MIXTURE OF STEREO;5,9,13-Pentadecatriene-2-one, 6,10,14-trimethyl-;Pentadeca-5,9,13-triene-2-one, 6,10,14-trimethyl-;farnesylacetone, mixture of stereo isomers;6,10,14-trimethylpentadeca-5,9,13-trien-2-one;FARNESYLACETONE, MIXTURE OF ISOMERS, 97% | | CAS: | 762-29-8 | | MF: | C18H30O | | MW: | 262.43 | | EINECS: | 212-097-9 | | Product Categories: | Building Blocks;C15 to C38;Carbonyl Compounds;Chemical Synthesis;Ketones;Organic Building Blocks | | Mol File: | 762-29-8.mol |  |
| | Farnesylacetone Chemical Properties |
| Melting point | 80.5-81.5 °C | | Boiling point | 120-121 °C(Press: 0.45 Torr) | | density | 0.88 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.481 | | FEMA | 3442 | 2,6,10-TRIMETHYL-2,6,10-PENTADECATRIEN-14-ONE | | Fp | 110°C | | Odor | at 100.00 %. fruity wine floral creamy | | Odor Type | fruity | | JECFA Number | 1123 | | BRN | 1781239 | | Cosmetics Ingredients Functions | PERFUMING | | InChI | 1S/C18H30O/c1-15(2)9-6-10-16(3)11-7-12-17(4)13-8-14-18(5)19/h9,11,13H,6-8,10,12,14H2,1-5H3 | | InChIKey | LTUMRKDLVGQMJU-UHFFFAOYSA-N | | SMILES | C\C(C)=C\CCC(C)=CCCC(C)=CCCC(C)=O | | LogP | 6.16 | | CAS DataBase Reference | 762-29-8(CAS DataBase Reference) | | NIST Chemistry Reference | 5,9,13-Pentadecatrien-2-one, 6,10,14-trimethyl-(762-29-8) | | EPA Substance Registry System | 5,9,13-Pentadecatrien-2-one, 6,10,14-trimethyl- (762-29-8) |
| Safety Statements | 24/25 | | WGK Germany | 2 | | TSCA | TSCA listed | | HS Code | 39039000 | | Storage Class | 10 - Combustible liquids |
| | Farnesylacetone Usage And Synthesis |
| Chemical Properties | 2,6,10-Trimethyl-2,6,10-pentadecatrien-14-one has an intensely sweet, floral odor. | | Occurrence | Reported found in tomato, grapefruit juice, melon, cardamom, rice, buckwheat, lemon balm and sweet
grass oil. | | Uses | Farnesalacetone is an intermediate in the synthesis of intermediates in the biosynthesis of carotenoids. | | Preparation | By treating farnesyl bromide with sodium acetate, followed by treating with methanolic KOH. |
| | Farnesylacetone Preparation Products And Raw materials |
|