- perfluorobenzonitrile
-
- $8.00 / 1KG
-
2025-09-25
- CAS:773-82-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
- Pentafluorobenzonitrile
-
- $6.00 / 1kg
-
2025-07-29
- CAS:773-82-0
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 2000KG/Month
|
| | Pentafluorobenzonitrile Basic information |
| | Pentafluorobenzonitrile Chemical Properties |
| Melting point | 2.4 °C | | Boiling point | 162-164 °C(lit.) | | density | 1.532 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.442(lit.) | | Fp | 85 °F | | storage temp. | Sealed in dry,2-8°C | | form | clear liquid | | color | Colorless to Almost colorless | | BRN | 1913453 | | Exposure limits | NIOSH: IDLH 25 mg/m3 | | InChI | InChI=1S/C7F5N/c8-3-2(1-13)4(9)6(11)7(12)5(3)10 | | InChIKey | YXWJGZQOGXGSSC-UHFFFAOYSA-N | | SMILES | C(#N)C1=C(F)C(F)=C(F)C(F)=C1F | | CAS DataBase Reference | 773-82-0(CAS DataBase Reference) | | NIST Chemistry Reference | Benzonitrile, pentafluoro-(773-82-0) | | EPA Substance Registry System | Pentafluorobenzonitrile (773-82-0) |
| Hazard Codes | Xi,F,T | | Risk Statements | 10 | | Safety Statements | 16 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant/Flammable | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29269095 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3 |
| | Pentafluorobenzonitrile Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS TO VERY SLIGHTLY YELLOW LIQUID | | Uses | Pentafluorobenzonitrile is useful as a catalyst in organic reactions, and as well is useful in liquid-phase exfoliation of graphite for solubilized graphene. |
| | Pentafluorobenzonitrile Preparation Products And Raw materials |
|