| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
|
| Product Name: | L-AP3 | | Synonyms: | (R)-(+)-2-AMINO-3-PHOSPHONOPROPIONIC ACID;L(+)-2-AMINO-3-PHOSPHONOPROPANOIC ACID;L(+)-2-AMINO-3-PHOSPHONOPROPIONIC ACID;L-AP3;(R)-(+)-2-Amino-3-phosphonopropionic acid, 3-Phosphono-L-alanine, L-AP3;(2R)-2-Amino-3-phosphonopropionic acid;(R)-2-Amino-3-phosphonopropanoic acid;Phosphonoalanine | | CAS: | 23052-80-4 | | MF: | C3H8NO5P | | MW: | 169.07 | | EINECS: | | | Product Categories: | | | Mol File: | 23052-80-4.mol |  |
| | L-AP3 Chemical Properties |
| Melting point | 227-229 °C | | Boiling point | 481.6±55.0 °C(Predicted) | | density | 1.763±0.06 g/cm3(Predicted) | | storage temp. | 0-6°C | | pka | 1.22±0.10(Predicted) | | form | solid | | BRN | 3649605 | | Stability: | Hygroscopic | | InChI | 1S/C3H8NO5P/c4-2(3(5)6)1-10(7,8)9/h2H,1,4H2,(H,5,6)(H2,7,8,9)/t2-/m0/s1 | | InChIKey | LBTABPSJONFLPO-REOHCLBHSA-N | | SMILES | N[C@@H](CP(O)(O)=O)C(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 3-10 | | HS Code | 29310099 | | Storage Class | 11 - Combustible Solids |
| | L-AP3 Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Uses | L-AP3 is a selective antagonist of the PI-linked metabotropic glutamate response. | | Definition | ChEBI: (2R)-2-amino-3-phosphonopropanoic acid is a L-alpha-amino acid. | | Biochem/physiol Actions | Potent antagonist at metabotropic glutamic acid receptors. | | in vivo | L-AP3 has anticonvulsant activity in animals. L-AP3 blocks audiogenic seizures in DBA/2 mice[1]. |
| | L-AP3 Preparation Products And Raw materials |
|