| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
|
| Product Name: | MPPG | | Synonyms: | 2-(4-phosphonophenyl)alanine;(RS)-ALPHA-METHYL-4-PHOSPHONOPHENYLGLYCINE;(RS)-MPPG;MPPG;(+/-)-A-methyl-(4-phosphonophenyl)*glycine;(R,S)-a-Methyl-4-phosphonophenylglycine;(RS)-α-methyl-4-phosphonophenylglycine;2-amino-2-(4-phosphonophenyl)propanoic acid | | CAS: | 169209-65-8 | | MF: | C9H12NO5P | | MW: | 245.17 | | EINECS: | | | Product Categories: | Glutamate receptor | | Mol File: | 169209-65-8.mol |  |
| Boiling point | 507.9±60.0 °C(Predicted) | | density | 1.54±0.1 g/cm3(Predicted) | | storage temp. | Store at RT | | solubility | DMSO: <4mg/mL | | form | solid | | pka | 1+-.0.10(Predicted) | | color | off-white | | InChI | 1S/C9H12NO5P/c1-9(10,8(11)12)6-2-4-7(5-3-6)16(13,14)15/h2-5H,10H2,1H3,(H,11,12)(H2,13,14,15) | | InChIKey | PAONCRJPUQXPRW-UHFFFAOYSA-N | | SMILES | CC(N)(C(O)=O)c1ccc(cc1)P(O)(O)=O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| Uses | MPPG is a potent antagonist of L-AP4-induced effects. | | Biological Activity | Potent antagonist of L-AP4-induced effects in rat spinal cord, thalamic and hippocampal neurons, showing selectivity over (1S,3S)-ACPD-induced effects. Potent antagonist of mGlu receptors linked to adenylyl cyclase in adult rat cortical slices. |
| | MPPG Preparation Products And Raw materials |
|