| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
|
| Product Name: | taxane | | Synonyms: | Paclitaxel Impurity 7;6,10-Methanobenzocyclodecene, tetradecahydro-4,9,12a,13,13-pentamethyl-, (4R,4aR,6S,9R,10S,12aR)- | | CAS: | 1605-68-1 | | MF: | C20H36 | | MW: | 276.5 | | EINECS: | | | Product Categories: | | | Mol File: | 1605-68-1.mol |  |
| | taxane Chemical Properties |
| Boiling point | 338.5±9.0 °C(Predicted) | | density | 0.860±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C20H36/c1-14-7-6-11-20(5)12-10-17-15(2)8-9-16(13-18(14)20)19(17,3)4/h14-18H,6-13H2,1-5H3/t14-,15-,16+,17+,18-,20-/m1/s1 | | InChIKey | DKPFODGZWDEEBT-AFFULRRLSA-N | | SMILES | [C@@]12([H])[C@H](C)CCC[C@]1(C)CC[C@]1([H])C(C)(C)[C@]([H])(C2)CC[C@H]1C |
| | taxane Usage And Synthesis |
| Uses | Taxane is a microtubule-binding chemotherapeutic agent, isolated from the phloem (inner bark) of the Pacific yew, Taxus brevifolia. | | Definition | ChEBI: Taxane is a terpenoid fundamental parent and a diterpene. |
| | taxane Preparation Products And Raw materials |
|