Perfluorooctanoic acid ammonium salt manufacturers
- FLUORADFC-118
-
- $1.00
-
2026-10-10
- CAS:3825-26-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20t
|
| | Perfluorooctanoic acid ammonium salt Basic information |
| | Perfluorooctanoic acid ammonium salt Chemical Properties |
| Melting point | 163-165(dec.) | | density | 1,163 g/cm3 | | solubility | H2O: 0.1 g/mL, clear, colorless | | form | Solid | | BRN | 4286466 | | InChI | InChI=1S/C8HF15O2.H3N/c9-2(10,1(24)25)3(11,12)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)23;/h(H,24,25);1H3 | | InChIKey | YOALFLHFSFEMLP-UHFFFAOYSA-N | | SMILES | C(F)(F)(C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(=O)O.N | | CAS DataBase Reference | 3825-26-1(CAS DataBase Reference) | | EPA Substance Registry System | Ammonium perfluorooctanoate (3825-26-1) |
| Hazard Codes | Xn,Xi,T | | Risk Statements | 20/22-36/37-64-48/23-48/21/22-41-40-23-22-61 | | Safety Statements | 26-36-45-53 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 2 | | RTECS | RH0782000 | | F | 3-10 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HazardClass | 6.1(a) | | PackingGroup | II | | HS Code | 29159000 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Inhalation
Acute Tox. 4 Oral
Carc. 2
Eye Dam. 1
Lact.
Repr. 1B
STOT RE 1 | | Toxicity | LD50 orl-rat: 430 mg/kg AIHAAP 41,576,80 |
| | Perfluorooctanoic acid ammonium salt Usage And Synthesis |
| Chemical Properties | White solid powder | | Uses | For polymerization of fluorinated monomers. | | Uses | Polymerization of fluorinated monomers;
surfactant | | Hazard | Toxic by inhalation and skin contact. Liver
damage. Possible carcinogen. | | Health Hazard | Ammonium perfluorooctanoate
is an hepatotoxin in rats; there are no reports
of adverse effects in humans. | | Safety Profile | Confirmed carcinogen.
Poison by inhalation. Moderately toxic by
ingestion. An eye and skin irritant.
Experimental reproductive effects. When
heated to decomposition it emits toxic
fumes of Fand NH3. |
| | Perfluorooctanoic acid ammonium salt Preparation Products And Raw materials |
|