- D-Allose
-
- $0.00 / 1g
-
2026-04-17
- CAS:2595-97-3
- Min. Order: 1g
- Purity: 98%min
- Supply Ability: 1000g
- D-Allose
-
- $0.00 / 10G
-
2026-04-17
- CAS:2595-97-3
- Min. Order: 1G
- Purity: 99%
- Supply Ability: 1000G
- D-(+)-ALLOSE
-
- $10.00 / 1KG
-
2026-03-20
- CAS:2595-97-3
- Min. Order: 100KG
- Purity: 99%
- Supply Ability: 100 mt
|
| | D-(+)-ALLOSE Basic information |
| | D-(+)-ALLOSE Chemical Properties |
| Melting point | 148-150 °C(lit.) | | alpha | D20 +0.58° (4 min) +3.26° (10 min) +14.41° (final value, 20 hr; c = 5) | | Boiling point | 232.96°C (rough estimate) | | density | 1.2805 (rough estimate) | | refractive index | 14 ° (C=5, H2O) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | pka | 12.45±0.20(Predicted) | | form | Solid | | color | White | | Optical Rotation | [α]19/D +15°, c = 3.8 in H2O | | Water Solubility | almost transparency | | Merck | 14,280 | | BRN | 1724623 | | InChI | 1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4-,5-,6-/m1/s1 | | InChIKey | WQZGKKKJIJFFOK-QZABAPFNSA-N | | SMILES | OC[C@H]1O[C@@H](O)[C@H](O)[C@H](O)[C@@H]1O | | CAS DataBase Reference | 2595-97-3(CAS DataBase Reference) | | EPA Substance Registry System | D-Allose (2595-97-3) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | F | 3-10 | | HS Code | 29400090 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ACROS
| English |
| | D-(+)-ALLOSE Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | D-Allose is a rare naturally occurring monosaccharide, is known to exert anti-proliferative effects on cancer cells. The effects of D-Allose on the cellular membranes of hormone-refractory prostate ca
ncer cell line (DU145), hormone-sensitive prostate cancer cell line (LNCaP), and normal prostate epithelial cells (PrEC) were studied at the molecular level by phospholipid profiling using a shotgun l
ipidomic method. | | Definition | ChEBI: The D-enantiomer of allopyranose. |
| | D-(+)-ALLOSE Preparation Products And Raw materials |
|