|
|
| | alpha-D-Glucose pentaacetate Basic information |
| Product Name: | alpha-D-Glucose pentaacetate | | Synonyms: | 2,3,4,5,6-Penta-O-acetylhexose;alpha-d-Glucose 2,3,4,5,6-pentaacetate;d-Allose, pentaacetate(ester);Glucose acetate;Gulose pentaacetate;A,B-D-GLUCOSE PENTAACETATE;ALPHA, BETA-D-GLUCOSE PENTAACETATE;ALPHA, BETA-D-(+)-GLUCOSE PENTAACETATE (HIGH BETA) | | CAS: | 3891-59-6 | | MF: | C16H22O11 | | MW: | 390.34 | | EINECS: | 223-439-1 | | Product Categories: | | | Mol File: | 3891-59-6.mol |  |
| | alpha-D-Glucose pentaacetate Chemical Properties |
| Melting point | 110°C | | Boiling point | 435.58°C (rough estimate) | | density | 1.3984 (rough estimate) | | refractive index | 1.5376 (estimate) | | FEMA | 2524 | GLUCOSE PENTAACETATE | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | Appearance | White to off-white Solid | | Odor Type | odorless | | Water Solubility | 1.5g/L(18 ºC) | | Cosmetics Ingredients Functions | EMULSION STABILISING | | InChI | InChI=1S/C16H22O11/c1-8(18)23-7-14(25-10(3)20)16(27-12(5)22)15(26-11(4)21)13(6-17)24-9(2)19/h6,13-16H,7H2,1-5H3/t13-,14+,15+,16+/m0/s1 | | InChIKey | UAOKXEHOENRFMP-ZJIFWQFVSA-N | | SMILES | O=C[C@H](OC(=O)C)[C@@H](OC(=O)C)[C@H](OC(=O)C)[C@H](OC(=O)C)COC(=O)C | | LogP | 1.27 | | CAS DataBase Reference | 3891-59-6(CAS DataBase Reference) | | NIST Chemistry Reference | D-Glucose, 2,3,4,5,6-pentaacetate(3891-59-6) | | EPA Substance Registry System | Glucose 2,3,4,5,6-pentaacetate (3891-59-6) |
| TSCA | TSCA listed | | HS Code | 29400090 |
| | alpha-D-Glucose pentaacetate Usage And Synthesis |
| Chemical Properties | White solid | | Chemical Properties | Glucose pentaacetate is odorless, but has a bitter favor. | | Preparation | By acetylation of glucose using any number of techniques, including ZnCl2 and pyridine, sodium acetate, and acetic anhydride and pyridine. | | Taste threshold values | Taste characteristics at 100 ppm: bitter-like with a citrus tonic favor. | | Synthesis | General procedure for the synthesis of 2,3,4,5,6-D-glucose pentaacetate from D-anhydrous glucose and acetic anhydride: D-glucose (0.36 g; 2 mmol) was dissolved in N,N'-dimethylimidazolium or N,N'-butylmethyl H-phosphonate methyl ester (1 g) at room temperature, followed by slow addition of acetic anhydride (1.02 g; 10 mmol). Continuous stirring is required during the reaction, noting that the reaction is exothermic and the mixture will gradually become homogeneous. The reaction can be continued at room temperature for 15 hours or accelerated at 50 °C to completion in 5 hours. At the end of the reaction, the target product 2,3,4,5,6-D-glucose pentaacetate is precipitated by the addition of water (0.72 g) to give a final yield of 92%. | | References | [1] Patent: US2010/121075, 2010, A1. Location in patent: Page/Page column 8
[2] Heterocycles, 1987, vol. 26, # 6, p. 1549 - 1556
[3] Bulletin of the Chemical Society of Japan, 2010, vol. 83, # 7, p. 799 - 801
[4] Journal of Natural Products, 2011, vol. 74, # 8, p. 1812 - 1816 |
| | alpha-D-Glucose pentaacetate Preparation Products And Raw materials |
|