|
|
| | 1,4-Phenylenediacetonitrile Basic information |
| | 1,4-Phenylenediacetonitrile Chemical Properties |
| Melting point | 95-99 °C (lit.) | | Boiling point | 270.42°C (rough estimate) | | density | 1.1566 (rough estimate) | | refractive index | 1.6057 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Light yellow | | Water Solubility | Insoluble in water. | | BRN | 1866157 | | Exposure limits | NIOSH: IDLH 25 mg/m3 | | InChI | InChI=1S/C10H8N2/c11-7-5-9-1-2-10(4-3-9)6-8-12/h1-4H,5-6H2 | | InChIKey | FUQCKESKNZBNOG-UHFFFAOYSA-N | | SMILES | C1(CC#N)=CC=C(CC#N)C=C1 | | CAS DataBase Reference | 622-75-3(CAS DataBase Reference) | | NIST Chemistry Reference | 1,4-Benzenediacetonitrile(622-75-3) | | EPA Substance Registry System | 1,4-Benzenediacetonitrile (622-75-3) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-37/39-24/25-22-36 | | RIDADR | 3276 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29269090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1,4-Phenylenediacetonitrile Usage And Synthesis |
| Chemical Properties | Light yellow to brown crystalline powder | | Uses | 1,4-Phenylenediacetonitrile, is used as an important raw material and intermediate used in organic Synthesis, pharmaceuticals, agrochemicals and dyestuff. |
| | 1,4-Phenylenediacetonitrile Preparation Products And Raw materials |
|