|
|
| | 5,10,15,20-tetra(3-hydroxyphenyl)porphyrin Basic information |
| Product Name: | 5,10,15,20-tetra(3-hydroxyphenyl)porphyrin | | Synonyms: | Meso-Tetrakis(3-hydroxyphenyl)porphyrin;meso-tetra(m-hydroxylphenyl)porphine;meso-Tetra(3-hydroxyphenyl)porphine;3-[10,15,20-tris(3-hydroxyphenyl)-21,24-dihydroporphyrin-5-yl]phenol;meso-Tera(m-hydroxylphenyl)porphine;Phenol, 3,3',3'',3'''-(21H,23H-porphine-5,10,15,20-tetrayl)tetrakis-;5,10,15,20-Tetrak;5,10,15,20-tetrakis(3-hydroxyphenyl)porphyrin | | CAS: | 22112-79-4 | | MF: | C44H30N4O4 | | MW: | 678.73 | | EINECS: | | | Product Categories: | Porphyrins | | Mol File: | 22112-79-4.mol |  |
| | 5,10,15,20-tetra(3-hydroxyphenyl)porphyrin Chemical Properties |
| Melting point | >320 °C | | density | 1.401±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | Appearance | Dark purple to black Solid | | InChIKey | ZUELZXZJXUXJCH-LWQDQPMZSA-N | | SMILES | C1(C2C=CC=C(O)C=2)=C2N=C(C(C3C=CC=C(O)C=3)=C3NC(=C(C4C=CC=C(O)C=4)C4=NC(=C(C5C=CC=C(O)C=5)C5NC1=CC=5)C=C4)C=C3)C=C2 |c:20,t:8,23,35| |
| | 5,10,15,20-tetra(3-hydroxyphenyl)porphyrin Usage And Synthesis |
| | 5,10,15,20-tetra(3-hydroxyphenyl)porphyrin Preparation Products And Raw materials |
|