|
|
| | 5,10,15,20-Tetra-p-tolyl-21H,23H-porphine Basic information |
| Product Name: | 5,10,15,20-Tetra-p-tolyl-21H,23H-porphine | | Synonyms: | RARECHEM AS SA 0009;5 10 15 20-TETRA-P-TOLYL-21H 23H-PORPHI&;5,10,15,20-Tetra(4-methylphenyl)-21H,23H-porphine;meso-Tetra(4-methylphenyl)porphine;21H,23H-Porphine, 5,10,15,20-tetrakis(4-methylphenyl)-;Tetrakis(4-Methylphenyl)-porphine;5,10,15,20-Tetrakis(p-tolyl)porphyrin;5,10,15,20-Tetrakis(p-tolyl)porphyrin | | CAS: | 14527-51-6 | | MF: | C48H38N4 | | MW: | 670.84 | | EINECS: | | | Product Categories: | | | Mol File: | 14527-51-6.mol |  |
| | 5,10,15,20-Tetra-p-tolyl-21H,23H-porphine Chemical Properties |
| Melting point | >300℃ | | density | 1+-.0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Solid | | color | Pale purple to purple | | λmax | 648nm(Toluene)(lit.) | | InChIKey | SFQNUQLWBBZIOZ-PJEPRTEXSA-N | | SMILES | C1(C2=CC=C(C)C=C2)=C2N=C(C(C3=CC=C(C)C=C3)=C3NC(=C(C4=CC=C(C)C=C4)C4=NC(=C(C5=CC=C(C)C=C5)C5NC1=CC=5)C=C4)C=C3)C=C2 |c:20,t:8,23,35| |
| | 5,10,15,20-Tetra-p-tolyl-21H,23H-porphine Usage And Synthesis |
| Uses | meso-Tetra (4-Methylphenyl) Porphine is a synthetic tetra-tolylated porphyrin used for research. |
| | 5,10,15,20-Tetra-p-tolyl-21H,23H-porphine Preparation Products And Raw materials |
|