| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 5,10,15,20-Tetrakis(pentafluorophenyl)-21H,23H-porphine Basic information |
| Product Name: | 5,10,15,20-Tetrakis(pentafluorophenyl)-21H,23H-porphine | | Synonyms: | 5,10,15,20-Tetrakis(pentafluorophenyl)-21H,23H-porphine, 95% 100MG;5,10,15,20-Tetrakis(perfluorophenyl)porphyrin
5,10,15,20-Tetrakis(pentafluorophenyl)-21H,23H-porphine;5,10,15,20-Tetrakis(pentafluorophenyl)-21H,23H-porphine,95%;5,10,15,20-Tetrakis(pentafluorophenyl)porphyrin >=90.0% (HPLC);5,10,15,20-tetrakis(2,3,4,5,6-pentafluorophenyl)-21,22-dihydroporphyrin;5,10,15,20-Tetrakis(perfluorophenyl)porphyrin;meso-tetra(pentafluorophenyl)porphyrin;5,10,15,20-TETRAKIS-(2,3,4,5,6-PENTAFLUOROPHENYL)-21,23H-PORPHYRIN | | CAS: | 25440-14-6 | | MF: | C44H10F20N4 | | MW: | 974.55 | | EINECS: | | | Product Categories: | Porphyrins;Synthetic Porphyrins;Biochemistry;Photonic and Optical Materials;Phthalocyanine and Porphyrin Dyes;Porphyrines;organic building block | | Mol File: | 25440-14-6.mol |  |
| | 5,10,15,20-Tetrakis(pentafluorophenyl)-21H,23H-porphine Chemical Properties |
| density | 1.5032 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | Crystalline Powder | | color | Violet or purple | | λmax | 416 nm 507 nm (2nd) | | BRN | 604408 | | InChIKey | VJEVAXUMNMFKDT-OTHQCIQNSA-N | | SMILES | Fc1c(F)c(F)c(c(F)c1F)-c2c3ccc(n3)c(-c4c(F)c(F)c(F)c(F)c4F)c5ccc([nH]5)c(-c6c(F)c(F)c(F)c(F)c6F)c7ccc(n7)c(-c8c(F)c(F)c(F)c(F)c8F)c9ccc2[nH]9 | | CAS DataBase Reference | 25440-14-6 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 5,10,15,20-Tetrakis(pentafluorophenyl)-21H,23H-porphine Usage And Synthesis |
| Chemical Properties | violet or purple crystalline powder | | Uses | 5,10,15,20-Tetrakis(pentafluorophenyl)porphyrin has been used as a biomarker in a study. 1 | | General Description | Visit our Sensor Applications portal to learn more. |
| | 5,10,15,20-Tetrakis(pentafluorophenyl)-21H,23H-porphine Preparation Products And Raw materials |
|