| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
Adenosine 3',5'-cyclic monophosphorothioate, RP-isomer, triethylammonium salt manufacturers
|
| | Adenosine 3',5'-cyclic monophosphorothioate, RP-isomer, triethylammonium salt Basic information |
| Product Name: | Adenosine 3',5'-cyclic monophosphorothioate, RP-isomer, triethylammonium salt | | Synonyms: | adenosine-3’,5’-cyclicmonophosphorothioate,rp-isomer(rp-camps),triethylammonium;CAMPS-RP, TRIETHYLAMMONIUM SALT;CAMPS TEA, RP-ISOMER;ADENOSINE-3',5'-CYCLIC-MONOPHOSPHOROTHIOATE TRIETHYLAMMONIUM SALT RP ISOMER;ADENOSINE 3',5'-CYCLIC MONOPHOSPHOTHIOATE, RP-ISOMER TRIETHYLAMMONIUM SALT;ADENOSINE 3',5'-CYCLIC PHOSPHOROTHIOATE-RP, TRIETHYLAMMONIUM SALT;RP-CAMPS TRIETHYL AMMONIUM SALT;RP-CAMPS TEA | | CAS: | 151837-09-1 | | MF: | C16H27N6O5PS | | MW: | 446.46 | | EINECS: | | | Product Categories: | | | Mol File: | 151837-09-1.mol |  |
| | Adenosine 3',5'-cyclic monophosphorothioate, RP-isomer, triethylammonium salt Chemical Properties |
| storage temp. | -20°C | | solubility | H2O: soluble10mg/mL | | form | powder | | color | white to beige | | Water Solubility | Soluble to 100 mM in water | | λmax | 258 nm | | InChIKey | OXIPZMKSNMRTIV-NVGWRVNNSA-N | | SMILES | CCN(CC)CC.Nc1ncnc2n(cnc12)[C@@H]3O[C@@H]4COP(O)(=S)O[C@H]4[C@H]3O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Adenosine 3',5'-cyclic monophosphorothioate, RP-isomer, triethylammonium salt Usage And Synthesis |
| Uses | Rp-Cyclic AMPS acts as a non-hydrolyzable phosphorothioate analog of cAMP, a competitive inhibitor of cAMP-dependant protein kinases used to distinguish between cyclic AMP-dependant and cyclic AMP-independant contractile coupling mechanisms. | | Biochem/physiol Actions | Rp-Adenosine 3′,5′-cyclic monophosphorothioate triethylammonium salt is capable of inhibiting protein kinase A (PKA). | | storage | -20°C (desiccate) |
| | Adenosine 3',5'-cyclic monophosphorothioate, RP-isomer, triethylammonium salt Preparation Products And Raw materials |
|