- 4-Fluorophenylacetic acid
-
- $9.00 / 1KG
-
2025-09-25
- CAS:405-50-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 4-Fluorophenylacetic acid Basic information |
| | 4-Fluorophenylacetic acid Chemical Properties |
| Melting point | 81-83 °C (lit.) | | Boiling point | 164°C (2.25 torr) | | density | 1.1850 (estimate) | | Fp | >100°C | | storage temp. | Sealed in dry,Room Temperature | | pka | pK1:4.25 (25°C) | | form | Shiny Crystalline Powder or Flakes | | color | White | | Water Solubility | Insoluble in water. | | Merck | 14,4177 | | BRN | 972145 | | InChI | InChI=1S/C8H7FO2/c9-7-3-1-6(2-4-7)5-8(10)11/h1-4H,5H2,(H,10,11) | | InChIKey | MGKPFALCNDRSQD-UHFFFAOYSA-N | | SMILES | C1(CC(O)=O)=CC=C(F)C=C1 | | CAS DataBase Reference | 405-50-5(CAS DataBase Reference) | | NIST Chemistry Reference | Benzeneacetic acid, 4-fluoro-(405-50-5) | | EPA Substance Registry System | Benzeneacetic acid, 4-fluoro- (405-50-5) |
| Hazard Codes | Xi | | Risk Statements | 38-36/37/38 | | Safety Statements | 22-24/25-36/37/39-27-26 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29163900 | | Storage Class | 11 - Combustible Solids |
| | 4-Fluorophenylacetic acid Usage And Synthesis |
| Chemical Properties | white shiny crystalline powder or flakes | | Uses | 4-Fluorophenylacetic acid is used as an intermediate in the production of fluorinated anesthetics. | | Synthesis Reference(s) | Journal of the American Chemical Society, 78, p. 6037, 1956 DOI: 10.1021/ja01604a023 | | Purification Methods | Crystallise it from heptane, but it is best purified by distillation at high vacuum. [Bergmann et al. J Am Chem Soc 78 6037 1956, Beilstein 9 III 2261, 9 IV 1672.] |
| | 4-Fluorophenylacetic acid Preparation Products And Raw materials |
| Raw materials | 2,3-DICHLORO-5,8-DIHYDROXY-1,4-NAPHTHOQUINONE-->Benzaldehyde, 4-fluoro-, hydrazone (9CI)-->2,3,4,6-Tetra-O-pivaloyl-D-glucopyranosyl amine-->METHYL 4-FLUOROPHENYLACETATE-->4-Fluorobenzylboronic acid pinacol ester-->4-FLUOROPHENYLACETIC ACID ETHYL ESTER-->4-Fluorophenylacetylene-->4-Fluorobenzyl bromide-->4-Fluorostyrene-->4-Fluorobenzyl chloride | | Preparation Products | 4-Fluorophenylacetyl chloride-->1,2-BIS-(4-FLUOROPHENYL)ETHANONE-->4-FLUOROBENZYL ISOCYANATE-->N-(2,2-Dichloro-1-hydroxyethyl)-4-fluorobenzeneacetamide-->(4-Fluorophenyl)acetic-2,2-d2 Acid |
|