| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (3-Carboxypropyl)trimethylammonium chloride Basic information |
| Product Name: | (3-Carboxypropyl)trimethylammonium chloride | | Synonyms: | (3-Carboxypropyl)trimethylammonium chloride (Synonyms: γ-Butyrobetaine hydrochloride);(3-Carboxypropyl)trimethylammonium chloride (γ-Butyrobetaine hydrochloride);DEOXYCARNITINE HYDROCHLORIDE;(3-CARBOXYPROPYL)TRIMETHYLAMMONIUMCHLORI DE PRACTIC;(3-CARBOXYPROPYL)TRIMETHYLAMMONIUM CHLOR IDE, TECH.;(3-carboxypropyl)trimethyl-ammoniuchloride;3-carboxy-n,n,n-trimethyl-1-propanaminiuchloride;3-carboxy-n,n,n-trimethyl-1-propanaminiumchloride | | CAS: | 6249-56-5 | | MF: | C7H16ClNO2 | | MW: | 181.66 | | EINECS: | | | Product Categories: | Aliphatics;Intermediates | | Mol File: | 6249-56-5.mol |  |
| | (3-Carboxypropyl)trimethylammonium chloride Chemical Properties |
| Melting point | 220 °C (dec.) (lit.) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Water (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Pale Yellow | | InChI | 1S/C7H15NO2.ClH/c1-8(2,3)6-4-5-7(9)10;/h4-6H2,1-3H3;1H | | InChIKey | GNRKTORAJTTYIW-UHFFFAOYSA-N | | SMILES | [Cl-].C[N+](C)(C)CCCC(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | BP3850000 | | Storage Class | 11 - Combustible Solids |
| | (3-Carboxypropyl)trimethylammonium chloride Usage And Synthesis |
| Uses | (3-Carboxypropyl)trimethylammonium chloride is a synthetic carnitine related compound used as a transporter substrate in the cloning and sequencing of human carnitine transporter 2 (CT2). |
| | (3-Carboxypropyl)trimethylammonium chloride Preparation Products And Raw materials |
|