| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Acetylurea manufacturers
- Acetylurea
-
- $9.80
-
2020-01-10
- CAS:591-07-1
- Min. Order: 1KG
- Purity: ≥98%
- Supply Ability: 20 tons
|
| | Acetylurea Basic information |
| Product Name: | Acetylurea | | Synonyms: | 1-Acetylurea;Acetamide,N-(aminocarbonyl)-;Acetic acid, ureide;N-Carbamoylacetamide;N-aminocarbonylethanamide;NSC 2766;acetyl-ure;Monoacetylurea | | CAS: | 591-07-1 | | MF: | C3H6N2O2 | | MW: | 102.09 | | EINECS: | 209-698-3 | | Product Categories: | | | Mol File: | 591-07-1.mol |  |
| | Acetylurea Chemical Properties |
| Melting point | 216-218°C | | Boiling point | 191.38°C (rough estimate) | | density | 1.204 | | refractive index | 1.5110 (estimate) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Sparingly, Sonicated), Methanol (Slightly, Sonicated), Water (Slightly) | | pka | 13.00±0.70(Predicted) | | form | Solid | | color | White to Off-White | | Water Solubility | 13g/L(15 ºC) | | BRN | 1751301 | | InChI | InChI=1S/C3H6N2O2/c1-2(6)5-3(4)7/h1H3,(H3,4,5,6,7) | | InChIKey | GKRZNOGGALENQJ-UHFFFAOYSA-N | | SMILES | C(NC(N)=O)(=O)C | | CAS DataBase Reference | 591-07-1(CAS DataBase Reference) | | EPA Substance Registry System | Acetamide, N-(aminocarbonyl)- (591-07-1) |
| Safety Statements | 22-24/25 | | RTECS | AB4331500 | | TSCA | TSCA listed | | HS Code | 2924.19.8000 |
| Provider | Language |
|
ALFA
| English |
| | Acetylurea Usage And Synthesis |
| Uses | Acetylurea is used in the preparation Multiple urea derivative compounds which includes glycogen phosphorylase inhibitors | | Synthesis Reference(s) | The Journal of Organic Chemistry, 15, p. 249, 1950 DOI: 10.1021/jo01148a006 |
| | Acetylurea Preparation Products And Raw materials |
|