|
|
| | (R)-(+)-4-Isopropyl-2-oxazolidinone Basic information |
| | (R)-(+)-4-Isopropyl-2-oxazolidinone Chemical Properties |
| Melting point | 70-73 °C | | alpha | -18 º (c=1, ethanol) | | Boiling point | 239.22°C (rough estimate) | | density | 1.04 g/cm3 | | refractive index | 1.4300 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | very faint turbidity in EtOH | | pka | 12.72±0.40(Predicted) | | form | Crystalline Powder | | color | White | | Optical Rotation | [α]20/D +17°, c = 6 in ethanol | | Water Solubility | Soluble | | BRN | 5376658 | | InChI | InChI=1S/C6H11NO2/c1-4(2)5-3-9-6(8)7-5/h4-5H,3H2,1-2H3,(H,7,8)/t5-/m0/s1 | | InChIKey | YBUPWRYTXGAWJX-YFKPBYRVSA-N | | SMILES | O1C[C@@H](C(C)C)NC1=O | | CAS DataBase Reference | 95530-58-8(CAS DataBase Reference) |
| | (R)-(+)-4-Isopropyl-2-oxazolidinone Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | (R)-4-Isopropyloxazolidin-2-one is a biochemical reagent that can be used as a biological material or organic compound for life science related research. | | Synthesis | To a dry Schlenk tube containing DMSO-d6 (1 mL) and cesium carbonate (33 mg, 0.1 mmol) was added (S)-1a (0.1114 mL, 1 mmol). The reaction mixture was frozen in a liquid nitrogen bath (-196 °C), followed by evacuation to remove air and replacement with CO2 gas. After thawing to 25 °C, a balloon (1 L) containing CO2 was connected to the reaction tube. The reaction system was stirred at 150°C for 24 hours. Upon completion of the reaction, the crude product was analyzed by 1H NMR and the yield was calculated using the internal standard N,N-dimethylformamide as reference. Subsequently, DMSO-d6 was removed by distillation under reduced pressure conditions (6 mmHg, 50 °C).The residue was purified by silica gel column chromatography (eluent: hexane/ethyl acetate, 3:1) to afford the target product (S)-4-isopropyloxazolidin-2-one ((S)-2a) as a white solid in 80% isolated yield (103.3 mg, 0.80 mmol). | | References | [1] Journal of Organic Chemistry, 2000, vol. 65, # 15, p. 4759 - 4761
[2] Tetrahedron Letters, 2013, vol. 54, # 35, p. 4717 - 4720 |
| | (R)-(+)-4-Isopropyl-2-oxazolidinone Preparation Products And Raw materials |
|