| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- 3-ACETYLBENZOIC ACID
-
- $9.90
-
2026-03-20
- CAS:586-42-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
- 3-Acetylbenzoic acid
-
- $5.00
-
2024-04-28
- CAS:586-42-5
- Min. Order: 1kg
- Purity: 99.92%
- Supply Ability: 50000tons
- 3-acetylbenzoic acid
-
- $380.00
-
2024-02-28
- CAS:586-42-5
- Min. Order: 1g
- Purity: 98
- Supply Ability: 500 Kg
|
| | 3-Acetylbenzoic acid Basic information |
| | 3-Acetylbenzoic acid Chemical Properties |
| Melting point | 163-171 °C | | Boiling point | 251.61°C (rough estimate) | | density | 1.2132 (rough estimate) | | refractive index | 1.5380 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | pka | pK1: 3.83 (25°C) | | form | Crystalline Powder | | color | White to light brown | | InChI | InChI=1S/C9H8O3/c1-6(10)7-3-2-4-8(5-7)9(11)12/h2-5H,1H3,(H,11,12) | | InChIKey | CHZPJUSFUDUEMZ-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC(C(C)=O)=C1 | | CAS DataBase Reference | 586-42-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26-36-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29183000 | | Storage Class | 11 - Combustible Solids |
| | 3-Acetylbenzoic acid Usage And Synthesis |
| Chemical Properties | white to light brown crystalline powder | | Uses | 3-Acetylbenzoic acid has been used in preparation of 3-(2-hydroxyethyl)benzyl alcohol and methyl 3-acetylbenzoate. |
| | 3-Acetylbenzoic acid Preparation Products And Raw materials |
|