|
|
| | 3-Aminobenzonitrile Basic information |
| | 3-Aminobenzonitrile Chemical Properties |
| Melting point | 48-53 °C(lit.) | | Boiling point | 288-290 °C | | density | 1.5511 (rough estimate) | | refractive index | 1.5500 (estimate) | | Fp | 112 °C | | solubility | soluble in Methanol | | pka | 2.75(at 25℃) | | form | Crystalline Solid | | color | Brown | | BRN | 636498 | | InChI | InChI=1S/C7H6N2/c8-5-6-2-1-3-7(9)4-6/h1-4H,9H2 | | InChIKey | NJXPYZHXZZCTNI-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC=CC(N)=C1 | | CAS DataBase Reference | 2237-30-1(CAS DataBase Reference) | | NIST Chemistry Reference | Benzonitrile, 3-amino-(2237-30-1) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-43-22-36/37/38 | | Safety Statements | 36/37-36-26 | | RIDADR | 3276 | | WGK Germany | 3 | | RTECS | DI2454000 | | Hazard Note | Harmful | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29214200 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Skin Sens. 1 |
| | 3-Aminobenzonitrile Usage And Synthesis |
| Chemical Properties | BROWN CRYSTALLINE SOLID | | Uses | 3-Aminobenzonitrile was used in the synthesis of series of 1-substituted-3(5)-(6-methylpyridin-2-yl)-4-(quinoxalin-6-yl)pyrazoles. It was also used in the preparation of highly substituted γ-lactam analogues of a thiazolidinone follicle stimulating hormone receptor agonist. | | General Description | 3-Aminobenzonitrile on condensation reaction with 4-isothiocyanato-4-methyl pentane-2-one gives condensed monocyclic pyrimidine derivatives. | | Synthesis | Dehydration: In the 1000ml reaction flask with brine-cooled reflux device, add 510g of toluene, 102g of 3-aminobenzamide (0.75mol), raise the temperature to 90-100, slowly add 205g of sulfoxide chloride (1.72mol), there is a large amount of off-gas generation (HCl + SO2), sulfoxide drops after the end of, and continue to hold the temperature to the material is all dissolved clear and no off-gas After the sulfoxide chloride drop, continue to keep warm until the material is all dissolved and no exhaust gas is released. Cooled to 50 ~ 60 , that is, the dehydration of liquid, insulation for use. _x000D
Hydrolysis: add 102g of water in 1000ml reaction bottle, stirring temperature to 50-60 , add the above dehydration solution, at this time there is tail gas (SO2), control the drop acceleration, drop stirring to no tail gas release, while hot, 30% sodium hydroxide solution to adjust the aqueous layer of pH to 6.5-7.5. Static layering, the organic layer of slow stirring and cooling to 0-5 , filtration, appropriate amount of 0-5 toluene wash, filtering, and the water is not used. Appropriate amount of 0-5 toluene washing, drying to obtain m-aminobenzonitrile 80.8g, yield 91.3%, GC purity 99.6%. |
| | 3-Aminobenzonitrile Preparation Products And Raw materials |
|