|
|
| | CYCLO(-ALA-GLN) Basic information |
| Product Name: | CYCLO(-ALA-GLN) | | Synonyms: | CYCLO(-ALA-GLN);Cyclo(-Ala-Gln) ,98%;Cyclo(L-Ala-L-Gln);3-((2S,5S)-5-methyl-3,6-dioxopiperazin-2-yl)propanamide;Alanyl Glutamine Impurity Ⅰ:Cyclo(L-Ala-L-Gln);L-Alanyl-L-Glutamine impurity 22;circle -(L- alanyl -L- glutamine);Ring-(L-alanyl-L glutamine) | | CAS: | 268221-76-7 | | MF: | C8H13N3O3 | | MW: | 199.21 | | EINECS: | | | Product Categories: | | | Mol File: | 268221-76-7.mol |  |
| | CYCLO(-ALA-GLN) Chemical Properties |
| Boiling point | 670.3±40.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | storage temp. | -15°C | | pka | 13.04±0.60(Predicted) | | InChI | InChI=1S/C8H13N3O3/c1-4-7(13)11-5(8(14)10-4)2-3-6(9)12/h4-5H,2-3H2,1H3,(H2,9,12)(H,10,14)(H,11,13)/t4-,5-/m0/s1 | | InChIKey | PNSKRAHOHQWAAN-WHFBIAKZSA-N | | SMILES | N1C(=O)[C@H](C)NC(=O)[C@@H]1CCC(N)=O |
| | CYCLO(-ALA-GLN) Usage And Synthesis |
| Chemical Properties | Solid | | Uses | Cyclo(-Ala-Gln) is a cyclic dipeptide with anti-biofilm and anti-adherence properties against oral pathogens. |
| | CYCLO(-ALA-GLN) Preparation Products And Raw materials |
|