| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (R)-N-BOC-3-Chlorophenylalanine Basic information |
| | (R)-N-BOC-3-Chlorophenylalanine Chemical Properties |
| Melting point | 110°C | | Boiling point | 452.5±40.0 °C(Predicted) | | density | 1.245 | | storage temp. | Sealed in dry,2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 3.81±0.10(Predicted) | | Appearance | White to off-white Solid | | Major Application | peptide synthesis | | InChI | 1S/C14H18ClNO4/c1-14(2,3)20-13(19)16-11(12(17)18)8-9-5-4-6-10(15)7-9/h4-7,11H,8H2,1-3H3,(H,16,19)(H,17,18)/t11-/m1/s1 | | InChIKey | RCZHBTHQISEPPP-LLVKDONJSA-N | | SMILES | CC(C)(C)OC(=O)N[C@H](Cc1cccc(Cl)c1)C(O)=O | | CAS DataBase Reference | 80102-25-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | (R)-N-BOC-3-Chlorophenylalanine Usage And Synthesis |
| Chemical Properties | White powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | (R)-N-BOC-3-Chlorophenylalanine Preparation Products And Raw materials |
|