|
|
| | (4-Chloro-3-pyridinyl)methanol Basic information | | Uses |
| Product Name: | (4-Chloro-3-pyridinyl)methanol | | Synonyms: | 4-chloro-3-PyridineMethanol;(4-Chloropyridin-3-yl)methanol, 4-Chloronicotinyl alcohol;(4-Chloro-3-pyridinyl)methanol;(4-Chloro-pyridin-3-yl)-methanol;3-Pyridinemethanol,4-chloro-(9CI);4-Chloro-3-pyridylcarbinol;4-Chloro-3-(hydroxymethyl)pyridine;2-Chloro-5-pyridylcarbinol | | CAS: | 189449-41-0 | | MF: | C6H6ClNO | | MW: | 143.57 | | EINECS: | | | Product Categories: | Heterocyclic Compounds;PYRIDINE | | Mol File: | 189449-41-0.mol |  |
| | (4-Chloro-3-pyridinyl)methanol Chemical Properties |
| Melting point | 87-90 °C | | Boiling point | 262.8±25.0 °C(Predicted) | | density | 1.324±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 13.00±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H6ClNO/c7-6-1-2-8-3-5(6)4-9/h1-3,9H,4H2 | | InChIKey | FYKNUGKDTZRYJM-UHFFFAOYSA-N | | SMILES | C1=NC=CC(Cl)=C1CO |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2933399990 |
| | (4-Chloro-3-pyridinyl)methanol Usage And Synthesis |
| Uses | 4-Chloro-3-pyridinemethanol is used as a reagent in organic synthesis or as a pharmaceutical intermediate. | | References | [1] Synthesis, 1999, # 8, p. 1294 - 1296
[2] Bioorganic and Medicinal Chemistry, 2005, vol. 13, # 20, p. 5841 - 5863
[3] Tetrahedron, 2006, vol. 62, # 10, p. 2240 - 2246
[4] Journal of Medicinal Chemistry, 2002, vol. 45, # 13, p. 2832 - 2840
[5] Patent: US6025352, 2000, A |
| | (4-Chloro-3-pyridinyl)methanol Preparation Products And Raw materials |
|