| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Bis(3 5 3' 5'-dimethoxydibenzylideneace& Basic information |
| Product Name: | Bis(3 5 3' 5'-dimethoxydibenzylideneace& | | Synonyms: | Bis(3,5,3’,5’-dimethoxydibenzylideneacetone)palladium(0) (Pd(dmdba)2);Bis(3,5,3',5'-dimethoxydibenzylideneacetone)palladium;diMethoxydibenzylideneacetone)palladiuM(0);Bis(3,5,3',5′-diMethoxydibenz;Bis(3,5,3',5'-diMethoxydibenzylideneacetone)palladiuM(0), Pd 13%;PalladiuM,bis[(1E,4E)-(1,2,4,5-h)-1,5-bis(3,5-diMethoxyphenyl)-1,4-pentadien-3-one]-;Bis[(1E,4E)-1,5-bis(3,5-diMethoxyphenyl)…;Bis(3,5,3',5'-dimethoxydibenzylideneacetone) | | CAS: | 811862-77-8 | | MF: | 2C21H22O5.Pd | | MW: | 815.22 | | EINECS: | | | Product Categories: | | | Mol File: | 811862-77-8.mol |  |
| | Bis(3 5 3' 5'-dimethoxydibenzylideneace& Chemical Properties |
| Melting point | 170-178 °C(lit.) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Powder | | color | Red-brown | | Water Solubility | Insoluble in water. | | InChI | InChI=1S/2C21H22O5.Pd/c2*1-23-18-9-15(10-19(13-18)24-2)5-7-17(22)8-6-16-11-20(25-3)14-21(12-16)26-4;/h2*5-14H,1-4H3;/b2*7-5+,8-6+; | | InChIKey | RTGAJOPJZJDWAX-XVGSOSPHSA-N | | SMILES | [CH](C1=CC(OC)=CC(OC)=C1)[CH]C(=O)[CH][CH]C1=CC(OC)=CC(OC)=C1.[CH](C1=CC(OC)=CC(OC)=C1)[CH]C(=O)[CH][CH]C1=CC(OC)=CC(OC)=C1.[Pd] |^1:0,11,14,15,26,37,40,41| |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Bis(3 5 3' 5'-dimethoxydibenzylideneace& Usage And Synthesis |
| Uses | suzuki reaction | | Uses | Bis(3,5,3',5'-dimethoxydibenzylideneacetone)palladium(0) used as catalyst in pharmaceutical research. | | General Description | Bis(3,5,3′,5′-dimethoxydibenzylideneacetone)palladium(0) is a non-phosphine based Pd(0) catalyst that can catalyze the Suzuki–Miyaura reaction of aryl chlorides with arylboronic acids with higher percentage conversion when compared to tris(dibenzylideneacetone)dipalladium(0) [Pd2(dba)3]. | | reaction suitability | core: palladium reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Cross Couplings reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: catalyst |
| | Bis(3 5 3' 5'-dimethoxydibenzylideneace& Preparation Products And Raw materials |
|