|
|
| | Benzophenone-2,3,4,5,6-d5 Basic information |
| Product Name: | Benzophenone-2,3,4,5,6-d5 | | Synonyms: | BENZOPHENONE-2,3,4,5,6-D5, 98 ATOM % D;Methanone, phenylphenyl-d5-;Benzophenone--d5;2,3,4,5,6-Pentadeuteriobenzophenon;Phenytoin EP Impurity A-d5 (Dimenhydrinate EP Impurity J-d5);Phenytoin EP Impurity A-d5;Benzophenone-2,3,4,5,6-d5;D5-Benzophenone | | CAS: | 2694-78-2 | | MF: | C13H5D5O | | MW: | 187.25 | | EINECS: | | | Product Categories: | Alphabetical Listings;B;Stable Isotopes | | Mol File: | 2694-78-2.mol |  |
| | Benzophenone-2,3,4,5,6-d5 Chemical Properties |
| Melting point | 47-51 °C(lit.) | | Boiling point | 305 °C(lit.) | | storage temp. | Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | 1S/C13H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H/i1D,3D,4D,7D,8D | | InChIKey | RWCCWEUUXYIKHB-DYVTXVBDSA-N | | SMILES | [2H]c1c([2H])c([2H])c(c([2H])c1[2H])C(=O)c2ccccc2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Aquatic Chronic 3
Carc. 1B
STOT RE 2 Oral |
| | Benzophenone-2,3,4,5,6-d5 Usage And Synthesis |
| Uses | Benzophenone-2,3,4,5,6-d5 is derived from Benzene-d6 (B185282), which is an isotope labelled benzene, an organic compound that is a natural constituent of crude oil and one of the most basic petrochemicals. |
| | Benzophenone-2,3,4,5,6-d5 Preparation Products And Raw materials |
|