| Company Name: |
Shanghai Jidu Biotechnology Co., Ltd. Gold
|
| Tel: |
13851761812 |
| Email: |
13851761812@163.com |
| Products Intro: |
Product Name:Benzophenone-d10
CAS:22583-75-1
Purity:98% Package:1g;5g;10g;100g
|
| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:Benzophenone-d10
CAS:22583-75-1
Remarks:CS-C-01611
|
BENZOPHENONE-D10 manufacturers
- Benzophenone-d10
-
- $0.00 / 5mg
-
2026-01-04
- CAS:22583-75-1
- Min. Order:
- Purity:
- Supply Ability: 10g
|
| | BENZOPHENONE-D10 Basic information |
| | BENZOPHENONE-D10 Chemical Properties |
| Melting point | 47-51 °C(lit.) | | Boiling point | 305 °C(lit.) | | Fp | 138℃ | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Stable. Hygroscopic. Incompatible with strong oxidising agents, strong reducing agents. | | InChI | 1S/C13H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D | | InChIKey | RWCCWEUUXYIKHB-LHNTUAQVSA-N | | SMILES | [2H]c1c([2H])c([2H])c(c([2H])c1[2H])C(=O)c2c([2H])c([2H])c([2H])c([2H])c2[2H] | | CAS Number Unlabeled | 119-61-9 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Aquatic Chronic 3
Carc. 1B
STOT RE 2 Oral |
| | BENZOPHENONE-D10 Usage And Synthesis |
| Chemical Properties | solid | | Uses | Benzophenone-d10, a labeled analogue of Benzophenone (B204980), is used in the manufacturing of antihistamines, hypnotics, insecticides.This compound is a contaminant of emerging concern (CECs) |
| | BENZOPHENONE-D10 Preparation Products And Raw materials |
|